4
0

jquery.nicescroll.js 119 KB

1234567891011121314151617181920212223242526272829303132333435363738394041424344454647484950515253545556575859606162636465666768697071727374757677787980818283848586878889909192939495969798991001011021031041051061071081091101111121131141151161171181191201211221231241251261271281291301311321331341351361371381391401411421431441451461471481491501511521531541551561571581591601611621631641651661671681691701711721731741751761771781791801811821831841851861871881891901911921931941951961971981992002012022032042052062072082092102112122132142152162172182192202212222232242252262272282292302312322332342352362372382392402412422432442452462472482492502512522532542552562572582592602612622632642652662672682692702712722732742752762772782792802812822832842852862872882892902912922932942952962972982993003013023033043053063073083093103113123133143153163173183193203213223233243253263273283293303313323333343353363373383393403413423433443453463473483493503513523533543553563573583593603613623633643653663673683693703713723733743753763773783793803813823833843853863873883893903913923933943953963973983994004014024034044054064074084094104114124134144154164174184194204214224234244254264274284294304314324334344354364374384394404414424434444454464474484494504514524534544554564574584594604614624634644654664674684694704714724734744754764774784794804814824834844854864874884894904914924934944954964974984995005015025035045055065075085095105115125135145155165175185195205215225235245255265275285295305315325335345355365375385395405415425435445455465475485495505515525535545555565575585595605615625635645655665675685695705715725735745755765775785795805815825835845855865875885895905915925935945955965975985996006016026036046056066076086096106116126136146156166176186196206216226236246256266276286296306316326336346356366376386396406416426436446456466476486496506516526536546556566576586596606616626636646656666676686696706716726736746756766776786796806816826836846856866876886896906916926936946956966976986997007017027037047057067077087097107117127137147157167177187197207217227237247257267277287297307317327337347357367377387397407417427437447457467477487497507517527537547557567577587597607617627637647657667677687697707717727737747757767777787797807817827837847857867877887897907917927937947957967977987998008018028038048058068078088098108118128138148158168178188198208218228238248258268278288298308318328338348358368378388398408418428438448458468478488498508518528538548558568578588598608618628638648658668678688698708718728738748758768778788798808818828838848858868878888898908918928938948958968978988999009019029039049059069079089099109119129139149159169179189199209219229239249259269279289299309319329339349359369379389399409419429439449459469479489499509519529539549559569579589599609619629639649659669679689699709719729739749759769779789799809819829839849859869879889899909919929939949959969979989991000100110021003100410051006100710081009101010111012101310141015101610171018101910201021102210231024102510261027102810291030103110321033103410351036103710381039104010411042104310441045104610471048104910501051105210531054105510561057105810591060106110621063106410651066106710681069107010711072107310741075107610771078107910801081108210831084108510861087108810891090109110921093109410951096109710981099110011011102110311041105110611071108110911101111111211131114111511161117111811191120112111221123112411251126112711281129113011311132113311341135113611371138113911401141114211431144114511461147114811491150115111521153115411551156115711581159116011611162116311641165116611671168116911701171117211731174117511761177117811791180118111821183118411851186118711881189119011911192119311941195119611971198119912001201120212031204120512061207120812091210121112121213121412151216121712181219122012211222122312241225122612271228122912301231123212331234123512361237123812391240124112421243124412451246124712481249125012511252125312541255125612571258125912601261126212631264126512661267126812691270127112721273127412751276127712781279128012811282128312841285128612871288128912901291129212931294129512961297129812991300130113021303130413051306130713081309131013111312131313141315131613171318131913201321132213231324132513261327132813291330133113321333133413351336133713381339134013411342134313441345134613471348134913501351135213531354135513561357135813591360136113621363136413651366136713681369137013711372137313741375137613771378137913801381138213831384138513861387138813891390139113921393139413951396139713981399140014011402140314041405140614071408140914101411141214131414141514161417141814191420142114221423142414251426142714281429143014311432143314341435143614371438143914401441144214431444144514461447144814491450145114521453145414551456145714581459146014611462146314641465146614671468146914701471147214731474147514761477147814791480148114821483148414851486148714881489149014911492149314941495149614971498149915001501150215031504150515061507150815091510151115121513151415151516151715181519152015211522152315241525152615271528152915301531153215331534153515361537153815391540154115421543154415451546154715481549155015511552155315541555155615571558155915601561156215631564156515661567156815691570157115721573157415751576157715781579158015811582158315841585158615871588158915901591159215931594159515961597159815991600160116021603160416051606160716081609161016111612161316141615161616171618161916201621162216231624162516261627162816291630163116321633163416351636163716381639164016411642164316441645164616471648164916501651165216531654165516561657165816591660166116621663166416651666166716681669167016711672167316741675167616771678167916801681168216831684168516861687168816891690169116921693169416951696169716981699170017011702170317041705170617071708170917101711171217131714171517161717171817191720172117221723172417251726172717281729173017311732173317341735173617371738173917401741174217431744174517461747174817491750175117521753175417551756175717581759176017611762176317641765176617671768176917701771177217731774177517761777177817791780178117821783178417851786178717881789179017911792179317941795179617971798179918001801180218031804180518061807180818091810181118121813181418151816181718181819182018211822182318241825182618271828182918301831183218331834183518361837183818391840184118421843184418451846184718481849185018511852185318541855185618571858185918601861186218631864186518661867186818691870187118721873187418751876187718781879188018811882188318841885188618871888188918901891189218931894189518961897189818991900190119021903190419051906190719081909191019111912191319141915191619171918191919201921192219231924192519261927192819291930193119321933193419351936193719381939194019411942194319441945194619471948194919501951195219531954195519561957195819591960196119621963196419651966196719681969197019711972197319741975197619771978197919801981198219831984198519861987198819891990199119921993199419951996199719981999200020012002200320042005200620072008200920102011201220132014201520162017201820192020202120222023202420252026202720282029203020312032203320342035203620372038203920402041204220432044204520462047204820492050205120522053205420552056205720582059206020612062206320642065206620672068206920702071207220732074207520762077207820792080208120822083208420852086208720882089209020912092209320942095209620972098209921002101210221032104210521062107210821092110211121122113211421152116211721182119212021212122212321242125212621272128212921302131213221332134213521362137213821392140214121422143214421452146214721482149215021512152215321542155215621572158215921602161216221632164216521662167216821692170217121722173217421752176217721782179218021812182218321842185218621872188218921902191219221932194219521962197219821992200220122022203220422052206220722082209221022112212221322142215221622172218221922202221222222232224222522262227222822292230223122322233223422352236223722382239224022412242224322442245224622472248224922502251225222532254225522562257225822592260226122622263226422652266226722682269227022712272227322742275227622772278227922802281228222832284228522862287228822892290229122922293229422952296229722982299230023012302230323042305230623072308230923102311231223132314231523162317231823192320232123222323232423252326232723282329233023312332233323342335233623372338233923402341234223432344234523462347234823492350235123522353235423552356235723582359236023612362236323642365236623672368236923702371237223732374237523762377237823792380238123822383238423852386238723882389239023912392239323942395239623972398239924002401240224032404240524062407240824092410241124122413241424152416241724182419242024212422242324242425242624272428242924302431243224332434243524362437243824392440244124422443244424452446244724482449245024512452245324542455245624572458245924602461246224632464246524662467246824692470247124722473247424752476247724782479248024812482248324842485248624872488248924902491249224932494249524962497249824992500250125022503250425052506250725082509251025112512251325142515251625172518251925202521252225232524252525262527252825292530253125322533253425352536253725382539254025412542254325442545254625472548254925502551255225532554255525562557255825592560256125622563256425652566256725682569257025712572257325742575257625772578257925802581258225832584258525862587258825892590259125922593259425952596259725982599260026012602260326042605260626072608260926102611261226132614261526162617261826192620262126222623262426252626262726282629263026312632263326342635263626372638263926402641264226432644264526462647264826492650265126522653265426552656265726582659266026612662266326642665266626672668266926702671267226732674267526762677267826792680268126822683268426852686268726882689269026912692269326942695269626972698269927002701270227032704270527062707270827092710271127122713271427152716271727182719272027212722272327242725272627272728272927302731273227332734273527362737273827392740274127422743274427452746274727482749275027512752275327542755275627572758275927602761276227632764276527662767276827692770277127722773277427752776277727782779278027812782278327842785278627872788278927902791279227932794279527962797279827992800280128022803280428052806280728082809281028112812281328142815281628172818281928202821282228232824282528262827282828292830283128322833283428352836283728382839284028412842284328442845284628472848284928502851285228532854285528562857285828592860286128622863286428652866286728682869287028712872287328742875287628772878287928802881288228832884288528862887288828892890289128922893289428952896289728982899290029012902290329042905290629072908290929102911291229132914291529162917291829192920292129222923292429252926292729282929293029312932293329342935293629372938293929402941294229432944294529462947294829492950295129522953295429552956295729582959296029612962296329642965296629672968296929702971297229732974297529762977297829792980298129822983298429852986298729882989299029912992299329942995299629972998299930003001300230033004300530063007300830093010301130123013301430153016301730183019302030213022302330243025302630273028302930303031303230333034303530363037303830393040304130423043304430453046304730483049305030513052305330543055305630573058305930603061306230633064306530663067306830693070307130723073307430753076307730783079308030813082308330843085308630873088308930903091309230933094309530963097309830993100310131023103310431053106310731083109311031113112311331143115311631173118311931203121312231233124312531263127312831293130313131323133313431353136313731383139314031413142314331443145314631473148314931503151315231533154315531563157315831593160316131623163316431653166316731683169317031713172317331743175317631773178317931803181318231833184318531863187318831893190319131923193319431953196319731983199320032013202320332043205320632073208320932103211321232133214321532163217321832193220322132223223322432253226322732283229323032313232323332343235323632373238323932403241324232433244324532463247324832493250325132523253325432553256325732583259326032613262326332643265326632673268326932703271327232733274327532763277327832793280328132823283328432853286328732883289329032913292329332943295329632973298329933003301330233033304330533063307330833093310331133123313331433153316331733183319332033213322332333243325332633273328332933303331333233333334333533363337333833393340334133423343334433453346334733483349335033513352335333543355335633573358335933603361336233633364336533663367336833693370337133723373337433753376337733783379338033813382338333843385338633873388338933903391339233933394339533963397339833993400340134023403340434053406340734083409341034113412341334143415341634173418341934203421342234233424342534263427342834293430343134323433343434353436343734383439344034413442344334443445344634473448344934503451345234533454345534563457345834593460346134623463346434653466346734683469347034713472347334743475347634773478347934803481348234833484348534863487348834893490349134923493349434953496349734983499350035013502350335043505350635073508350935103511351235133514351535163517351835193520352135223523352435253526352735283529353035313532353335343535353635373538353935403541354235433544354535463547354835493550355135523553355435553556355735583559356035613562356335643565356635673568356935703571357235733574357535763577357835793580358135823583358435853586358735883589359035913592359335943595359635973598359936003601360236033604360536063607360836093610361136123613361436153616361736183619362036213622362336243625362636273628362936303631363236333634
  1. /* jquery.nicescroll
  2. -- version 3.6.0
  3. -- copyright 2014-11-21 InuYaksa*2014
  4. -- licensed under the MIT
  5. --
  6. -- http://nicescroll.areaaperta.com/
  7. -- https://github.com/inuyaksa/jquery.nicescroll
  8. --
  9. */
  10. (function(factory) {
  11. if (typeof define === 'function' && define.amd) {
  12. // AMD. Register as anonymous module.
  13. define(['jquery'], factory);
  14. } else {
  15. // Browser globals.
  16. factory(jQuery);
  17. }
  18. }(function(jQuery) {
  19. "use strict";
  20. // globals
  21. var domfocus = false;
  22. var mousefocus = false;
  23. var tabindexcounter = 0;
  24. var ascrailcounter = 2000;
  25. var globalmaxzindex = 0;
  26. var $ = jQuery; // sandbox
  27. // http://stackoverflow.com/questions/2161159/get-script-path
  28. function getScriptPath() {
  29. var scripts = document.getElementsByTagName('script');
  30. var path = scripts[scripts.length - 1].src.split('?')[0];
  31. return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
  32. }
  33. var vendors = ['webkit','ms','moz','o'];
  34. var setAnimationFrame = window.requestAnimationFrame || false;
  35. var clearAnimationFrame = window.cancelAnimationFrame || false;
  36. if (!setAnimationFrame) { // legacy detection
  37. for (var vx in vendors) {
  38. var v = vendors[vx];
  39. if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'];
  40. if (!clearAnimationFrame) clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
  41. }
  42. }
  43. var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
  44. var _globaloptions = {
  45. zindex: "auto",
  46. cursoropacitymin: 0,
  47. cursoropacitymax: 1,
  48. cursorcolor: "#424242",
  49. cursorwidth: "5px",
  50. cursorborder: "1px solid #fff",
  51. cursorborderradius: "5px",
  52. scrollspeed: 60,
  53. mousescrollstep: 8 * 3,
  54. touchbehavior: false,
  55. hwacceleration: true,
  56. usetransition: true,
  57. boxzoom: false,
  58. dblclickzoom: true,
  59. gesturezoom: true,
  60. grabcursorenabled: true,
  61. autohidemode: true,
  62. background: "",
  63. iframeautoresize: true,
  64. cursorminheight: 32,
  65. preservenativescrolling: true,
  66. railoffset: false,
  67. railhoffset: false,
  68. bouncescroll: true,
  69. spacebarenabled: true,
  70. railpadding: {
  71. top: 0,
  72. right: 0,
  73. left: 0,
  74. bottom: 0
  75. },
  76. disableoutline: true,
  77. horizrailenabled: true,
  78. railalign: "right",
  79. railvalign: "bottom",
  80. enabletranslate3d: true,
  81. enablemousewheel: true,
  82. enablekeyboard: true,
  83. smoothscroll: true,
  84. sensitiverail: true,
  85. enablemouselockapi: true,
  86. // cursormaxheight:false,
  87. cursorfixedheight: false,
  88. directionlockdeadzone: 6,
  89. hidecursordelay: 400,
  90. nativeparentscrolling: true,
  91. enablescrollonselection: true,
  92. overflowx: true,
  93. overflowy: true,
  94. cursordragspeed: 0.3,
  95. rtlmode: "auto",
  96. cursordragontouch: false,
  97. oneaxismousemode: "auto",
  98. scriptpath: getScriptPath(),
  99. preventmultitouchscrolling: true
  100. };
  101. var browserdetected = false;
  102. var getBrowserDetection = function() {
  103. if (browserdetected) return browserdetected;
  104. var _el = document.createElement('DIV'),
  105. _style = _el.style,
  106. _agent = navigator.userAgent,
  107. _platform = navigator.platform,
  108. d = {};
  109. d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
  110. d.isopera = ("opera" in window); // 12-
  111. d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
  112. d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
  113. d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
  114. d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
  115. d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
  116. d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
  117. d.isie9 = d.isie && ("performance" in window) && (document.documentMode >= 9);
  118. d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
  119. d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
  120. d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
  121. if (d.isie9mobile) d.isie9 = false;
  122. d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
  123. d.ismozilla = ("MozAppearance" in _style);
  124. d.iswebkit = ("WebkitAppearance" in _style);
  125. d.ischrome = ("chrome" in window);
  126. d.ischrome22 = (d.ischrome && d.haspointerlock);
  127. d.ischrome26 = (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
  128. d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // detection for Chrome Touch Emulation
  129. d.hasmstouch = (window.MSPointerEvent || false); // IE10 pointer events
  130. d.hasw3ctouch = (window.PointerEvent || false); //IE11 pointer events, following W3C Pointer Events spec
  131. d.ismac = /^mac$/i.test(_platform);
  132. d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
  133. d.isios4 = ((d.isios) && !("seal" in Object));
  134. d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+
  135. d.isandroid = (/android/i.test(_agent));
  136. d.haseventlistener = ("addEventListener" in _el);
  137. d.trstyle = false;
  138. d.hastransform = false;
  139. d.hastranslate3d = false;
  140. d.transitionstyle = false;
  141. d.hastransition = false;
  142. d.transitionend = false;
  143. var a;
  144. var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
  145. for (a = 0; a < check.length; a++) {
  146. if (typeof _style[check[a]] != "undefined") {
  147. d.trstyle = check[a];
  148. break;
  149. }
  150. }
  151. d.hastransform = (!!d.trstyle);
  152. if (d.hastransform) {
  153. _style[d.trstyle] = "translate3d(1px,2px,3px)";
  154. d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
  155. }
  156. d.transitionstyle = false;
  157. d.prefixstyle = '';
  158. d.transitionend = false;
  159. check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
  160. var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
  161. var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
  162. for (a = 0; a < check.length; a++) {
  163. if (check[a] in _style) {
  164. d.transitionstyle = check[a];
  165. d.prefixstyle = prefix[a];
  166. d.transitionend = evs[a];
  167. break;
  168. }
  169. }
  170. if (d.ischrome26) { // always use prefix
  171. d.prefixstyle = prefix[1];
  172. }
  173. d.hastransition = (d.transitionstyle);
  174. function detectCursorGrab() {
  175. var lst = ['-webkit-grab', '-moz-grab', 'grab'];
  176. if ((d.ischrome && !d.ischrome22) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
  177. for (var a = 0; a < lst.length; a++) {
  178. var p = lst[a];
  179. _style.cursor = p;
  180. if (_style.cursor == p) return p;
  181. }
  182. return 'url(//mail.google.com/mail/images/2/openhand.cur),n-resize'; // thank you google for custom cursor!
  183. }
  184. d.cursorgrabvalue = detectCursorGrab();
  185. d.hasmousecapture = ("setCapture" in _el);
  186. d.hasMutationObserver = (ClsMutationObserver !== false);
  187. _el = null; //memory released
  188. browserdetected = d;
  189. return d;
  190. };
  191. var NiceScrollClass = function(myopt, me) {
  192. var self = this;
  193. this.version = '3.6.0';
  194. this.name = 'nicescroll';
  195. this.me = me;
  196. this.opt = {
  197. doc: $("body"),
  198. win: false
  199. };
  200. $.extend(this.opt, _globaloptions); // clone opts
  201. // Options for internal use
  202. this.opt.snapbackspeed = 80;
  203. if (myopt || false) {
  204. for (var a in self.opt) {
  205. if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
  206. }
  207. }
  208. this.doc = self.opt.doc;
  209. this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
  210. this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
  211. this.haswrapper = (self.opt.win !== false);
  212. this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
  213. this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
  214. this.body = $("body");
  215. this.viewport = false;
  216. this.isfixed = false;
  217. this.iframe = false;
  218. this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
  219. this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
  220. this.forcescreen = false; //force to use screen position on events
  221. this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
  222. // Events jump table
  223. this.onmousedown = false;
  224. this.onmouseup = false;
  225. this.onmousemove = false;
  226. this.onmousewheel = false;
  227. this.onkeypress = false;
  228. this.ongesturezoom = false;
  229. this.onclick = false;
  230. // Nicescroll custom events
  231. this.onscrollstart = false;
  232. this.onscrollend = false;
  233. this.onscrollcancel = false;
  234. this.onzoomin = false;
  235. this.onzoomout = false;
  236. // Let's start!
  237. this.view = false;
  238. this.page = false;
  239. this.scroll = {
  240. x: 0,
  241. y: 0
  242. };
  243. this.scrollratio = {
  244. x: 0,
  245. y: 0
  246. };
  247. this.cursorheight = 20;
  248. this.scrollvaluemax = 0;
  249. this.isrtlmode = (this.opt.rtlmode == "auto") ? ((this.win[0] == window ? this.body : this.win).css("direction") == "rtl") : (this.opt.rtlmode === true);
  250. // this.checkrtlmode = false;
  251. this.scrollrunning = false;
  252. this.scrollmom = false;
  253. this.observer = false; // observer div changes
  254. this.observerremover = false; // observer on parent for remove detection
  255. this.observerbody = false; // observer on body for position change
  256. do {
  257. this.id = "ascrail" + (ascrailcounter++);
  258. } while (document.getElementById(this.id));
  259. this.rail = false;
  260. this.cursor = false;
  261. this.cursorfreezed = false;
  262. this.selectiondrag = false;
  263. this.zoom = false;
  264. this.zoomactive = false;
  265. this.hasfocus = false;
  266. this.hasmousefocus = false;
  267. this.visibility = true;
  268. this.railslocked = false; // locked by resize
  269. this.locked = false; // prevent lost of locked status sets by user
  270. this.hidden = false; // rails always hidden
  271. this.cursoractive = true; // user can interact with cursors
  272. this.wheelprevented = false; //prevent mousewheel event
  273. this.overflowx = self.opt.overflowx;
  274. this.overflowy = self.opt.overflowy;
  275. this.nativescrollingarea = false;
  276. this.checkarea = 0;
  277. this.events = []; // event list for unbind
  278. this.saved = {}; // style saved
  279. this.delaylist = {};
  280. this.synclist = {};
  281. this.lastdeltax = 0;
  282. this.lastdeltay = 0;
  283. this.detected = getBrowserDetection();
  284. var cap = $.extend({}, this.detected);
  285. this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
  286. this.ishwscroll = (this.canhwscroll && self.haswrapper);
  287. this.hasreversehr = (this.isrtlmode&&!cap.iswebkit); //RTL mode with reverse horizontal axis
  288. this.istouchcapable = false; // desktop devices with touch screen support
  289. //## Check WebKit-based desktop with touch support
  290. //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
  291. if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
  292. this.istouchcapable = true;
  293. cap.cantouch = false; // parse normal desktop events
  294. }
  295. //## disable MouseLock API on user request
  296. if (!self.opt.enablemouselockapi) {
  297. cap.hasmousecapture = false;
  298. cap.haspointerlock = false;
  299. }
  300. /* deprecated
  301. this.delayed = function(name, fn, tm, lazy) {
  302. };
  303. */
  304. this.debounced = function(name, fn, tm) {
  305. var dd = self.delaylist[name];
  306. self.delaylist[name] = fn;
  307. if (!dd) {
  308. setTimeout(function() {
  309. var fn = self.delaylist[name];
  310. self.delaylist[name] = false;
  311. fn.call(self);
  312. }, tm);
  313. }
  314. };
  315. var _onsync = false;
  316. this.synched = function(name, fn) {
  317. function requestSync() {
  318. if (_onsync) return;
  319. setAnimationFrame(function() {
  320. _onsync = false;
  321. for (var nn in self.synclist) {
  322. var fn = self.synclist[nn];
  323. if (fn) fn.call(self);
  324. self.synclist[nn] = false;
  325. }
  326. });
  327. _onsync = true;
  328. }
  329. self.synclist[name] = fn;
  330. requestSync();
  331. return name;
  332. };
  333. this.unsynched = function(name) {
  334. if (self.synclist[name]) self.synclist[name] = false;
  335. };
  336. this.css = function(el, pars) { // save & set
  337. for (var n in pars) {
  338. self.saved.css.push([el, n, el.css(n)]);
  339. el.css(n, pars[n]);
  340. }
  341. };
  342. this.scrollTop = function(val) {
  343. return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
  344. };
  345. this.scrollLeft = function(val) {
  346. return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
  347. };
  348. // derived by by Dan Pupius www.pupius.net
  349. var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
  350. this.st = st;
  351. this.ed = ed;
  352. this.spd = spd;
  353. this.p1 = p1 || 0;
  354. this.p2 = p2 || 1;
  355. this.p3 = p3 || 0;
  356. this.p4 = p4 || 1;
  357. this.ts = (new Date()).getTime();
  358. this.df = this.ed - this.st;
  359. };
  360. BezierClass.prototype = {
  361. B2: function(t) {
  362. return 3 * t * t * (1 - t);
  363. },
  364. B3: function(t) {
  365. return 3 * t * (1 - t) * (1 - t);
  366. },
  367. B4: function(t) {
  368. return (1 - t) * (1 - t) * (1 - t);
  369. },
  370. getNow: function() {
  371. var nw = (new Date()).getTime();
  372. var pc = 1 - ((nw - this.ts) / this.spd);
  373. var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
  374. return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
  375. },
  376. update: function(ed, spd) {
  377. this.st = this.getNow();
  378. this.ed = ed;
  379. this.spd = spd;
  380. this.ts = (new Date()).getTime();
  381. this.df = this.ed - this.st;
  382. return this;
  383. }
  384. };
  385. //derived from http://stackoverflow.com/questions/11236090/
  386. function getMatrixValues() {
  387. var tr = self.doc.css(cap.trstyle);
  388. if (tr && (tr.substr(0, 6) == "matrix")) {
  389. return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
  390. }
  391. return false;
  392. }
  393. if (this.ishwscroll) {
  394. // hw accelerated scroll
  395. this.doc.translate = {
  396. x: 0,
  397. y: 0,
  398. tx: "0px",
  399. ty: "0px"
  400. };
  401. //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
  402. if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
  403. this.getScrollTop = function(last) {
  404. if (!last) {
  405. var mtx = getMatrixValues();
  406. if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
  407. if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
  408. }
  409. return self.doc.translate.y;
  410. };
  411. this.getScrollLeft = function(last) {
  412. if (!last) {
  413. var mtx = getMatrixValues();
  414. if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
  415. if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
  416. }
  417. return self.doc.translate.x;
  418. };
  419. this.notifyScrollEvent = function(el) {
  420. var e = document.createEvent("UIEvents");
  421. e.initUIEvent("scroll", false, true, window, 1);
  422. e.niceevent = true;
  423. el.dispatchEvent(e);
  424. };
  425. var cxscrollleft = (this.isrtlmode) ? 1 : -1;
  426. if (cap.hastranslate3d && self.opt.enabletranslate3d) {
  427. this.setScrollTop = function(val, silent) {
  428. self.doc.translate.y = val;
  429. self.doc.translate.ty = (val * -1) + "px";
  430. self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
  431. if (!silent) self.notifyScrollEvent(self.win[0]);
  432. };
  433. this.setScrollLeft = function(val, silent) {
  434. self.doc.translate.x = val;
  435. self.doc.translate.tx = (val * cxscrollleft) + "px";
  436. self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
  437. if (!silent) self.notifyScrollEvent(self.win[0]);
  438. };
  439. } else {
  440. this.setScrollTop = function(val, silent) {
  441. self.doc.translate.y = val;
  442. self.doc.translate.ty = (val * -1) + "px";
  443. self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
  444. if (!silent) self.notifyScrollEvent(self.win[0]);
  445. };
  446. this.setScrollLeft = function(val, silent) {
  447. self.doc.translate.x = val;
  448. self.doc.translate.tx = (val * cxscrollleft) + "px";
  449. self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
  450. if (!silent) self.notifyScrollEvent(self.win[0]);
  451. };
  452. }
  453. } else {
  454. // native scroll
  455. this.getScrollTop = function() {
  456. return self.docscroll.scrollTop();
  457. };
  458. this.setScrollTop = function(val) {
  459. return self.docscroll.scrollTop(val);
  460. };
  461. this.getScrollLeft = function() {
  462. if (self.detected.ismozilla && self.isrtlmode)
  463. return Math.abs(self.docscroll.scrollLeft());
  464. return self.docscroll.scrollLeft();
  465. };
  466. this.setScrollLeft = function(val) {
  467. return self.docscroll.scrollLeft((self.detected.ismozilla && self.isrtlmode) ? -val : val);
  468. };
  469. }
  470. this.getTarget = function(e) {
  471. if (!e) return false;
  472. if (e.target) return e.target;
  473. if (e.srcElement) return e.srcElement;
  474. return false;
  475. };
  476. this.hasParent = function(e, id) {
  477. if (!e) return false;
  478. var el = e.target || e.srcElement || e || false;
  479. while (el && el.id != id) {
  480. el = el.parentNode || false;
  481. }
  482. return (el !== false);
  483. };
  484. function getZIndex() {
  485. var dom = self.win;
  486. if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
  487. while (dom.length > 0) {
  488. if (dom[0].nodeType == 9) return false;
  489. var zi = dom.css('zIndex');
  490. if (!isNaN(zi) && zi != 0) return parseInt(zi);
  491. dom = dom.parent();
  492. }
  493. return false;
  494. }
  495. //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
  496. var _convertBorderWidth = {
  497. "thin": 1,
  498. "medium": 3,
  499. "thick": 5
  500. };
  501. function getWidthToPixel(dom, prop, chkheight) {
  502. var wd = dom.css(prop);
  503. var px = parseFloat(wd);
  504. if (isNaN(px)) {
  505. px = _convertBorderWidth[wd] || 0;
  506. var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
  507. if (self.isie8 && px) px += 1;
  508. return (brd) ? px : 0;
  509. }
  510. return px;
  511. }
  512. this.getDocumentScrollOffset = function() {
  513. return {top:window.pageYOffset||document.documentElement.scrollTop,
  514. left:window.pageXOffset||document.documentElement.scrollLeft};
  515. }
  516. this.getOffset = function() {
  517. if (self.isfixed) {
  518. var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
  519. var scrl = self.getDocumentScrollOffset();
  520. ofs.top-=scrl.top;
  521. ofs.left-=scrl.left;
  522. return ofs;
  523. }
  524. var ww = self.win.offset();
  525. if (!self.viewport) return ww;
  526. var vp = self.viewport.offset();
  527. return {
  528. top: ww.top - vp.top,// + self.viewport.scrollTop(),
  529. left: ww.left - vp.left // + self.viewport.scrollLeft()
  530. };
  531. };
  532. this.updateScrollBar = function(len) {
  533. if (self.ishwscroll) {
  534. self.rail.css({ //**
  535. height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
  536. });
  537. if (self.railh) self.railh.css({ //**
  538. width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
  539. });
  540. } else {
  541. var wpos = self.getOffset();
  542. var pos = {
  543. top: wpos.top,
  544. left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
  545. };
  546. pos.top += getWidthToPixel(self.win, 'border-top-width', true);
  547. pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
  548. var off = self.opt.railoffset;
  549. if (off) {
  550. if (off.top) pos.top += off.top;
  551. if (self.rail.align && off.left) pos.left += off.left;
  552. }
  553. if (!self.railslocked) self.rail.css({
  554. top: pos.top,
  555. left: pos.left,
  556. height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
  557. });
  558. if (self.zoom) {
  559. self.zoom.css({
  560. top: pos.top + 1,
  561. left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
  562. });
  563. }
  564. if (self.railh && !self.railslocked) {
  565. var pos = {
  566. top: wpos.top,
  567. left: wpos.left
  568. };
  569. var off = self.opt.railhoffset;
  570. if (!!off) {
  571. if (!!off.top) pos.top += off.top;
  572. if (!!off.left) pos.left += off.left;
  573. }
  574. var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
  575. var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
  576. self.railh.css({
  577. top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
  578. left: x,
  579. width: self.railh.width
  580. });
  581. }
  582. }
  583. };
  584. this.doRailClick = function(e, dbl, hr) {
  585. var fn, pg, cur, pos;
  586. if (self.railslocked) return;
  587. self.cancelEvent(e);
  588. if (dbl) {
  589. fn = (hr) ? self.doScrollLeft : self.doScrollTop;
  590. cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
  591. fn(cur);
  592. } else {
  593. fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
  594. cur = (hr) ? self.scroll.x : self.scroll.y;
  595. pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
  596. pg = (hr) ? self.view.w : self.view.h;
  597. fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg);
  598. }
  599. };
  600. self.hasanimationframe = (setAnimationFrame);
  601. self.hascancelanimationframe = (clearAnimationFrame);
  602. if (!self.hasanimationframe) {
  603. setAnimationFrame = function(fn) {
  604. return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
  605. }; // 1000/60)};
  606. clearAnimationFrame = clearInterval;
  607. } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
  608. self.cancelAnimationFrame = true;
  609. };
  610. this.init = function() {
  611. self.saved.css = [];
  612. if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
  613. if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
  614. if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
  615. '-ms-touch-action': 'none'
  616. });
  617. self.zindex = "auto";
  618. if (!self.ispage && self.opt.zindex == "auto") {
  619. self.zindex = getZIndex() || "auto";
  620. } else {
  621. self.zindex = self.opt.zindex;
  622. }
  623. if (!self.ispage && self.zindex != "auto") {
  624. if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex;
  625. }
  626. if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
  627. self.zindex = "auto";
  628. }
  629. if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
  630. var cont = self.docscroll;
  631. if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
  632. if (!cap.isie9mobile) self.css(cont, {
  633. 'overflow-y': 'hidden'
  634. });
  635. if (self.ispage && cap.isie7) {
  636. if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
  637. 'overflow-y': 'hidden'
  638. }); //IE7 double scrollbar issue
  639. else if (self.doc[0].nodeName == 'HTML') self.css($("body"), {
  640. 'overflow-y': 'hidden'
  641. }); //IE7 double scrollbar issue
  642. }
  643. if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
  644. "-webkit-overflow-scrolling": "touch"
  645. }); //force hw acceleration
  646. var cursor = $(document.createElement('div'));
  647. cursor.css({
  648. position: "relative",
  649. top: 0,
  650. "float": "right",
  651. width: self.opt.cursorwidth,
  652. height: "0px",
  653. 'background-color': self.opt.cursorcolor,
  654. border: self.opt.cursorborder,
  655. 'background-clip': 'padding-box',
  656. '-webkit-border-radius': self.opt.cursorborderradius,
  657. '-moz-border-radius': self.opt.cursorborderradius,
  658. 'border-radius': self.opt.cursorborderradius
  659. });
  660. cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
  661. cursor.addClass('nicescroll-cursors');
  662. self.cursor = cursor;
  663. var rail = $(document.createElement('div'));
  664. rail.attr('id', self.id);
  665. rail.addClass('nicescroll-rails nicescroll-rails-vr');
  666. var v, a, kp = ["left","right","top","bottom"]; //**
  667. for (var n in kp) {
  668. a = kp[n];
  669. v = self.opt.railpadding[a];
  670. (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
  671. }
  672. rail.append(cursor);
  673. rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
  674. rail.css({
  675. width: rail.width + "px",
  676. 'zIndex': self.zindex,
  677. "background": self.opt.background,
  678. cursor: "default"
  679. });
  680. rail.visibility = true;
  681. rail.scrollable = true;
  682. rail.align = (self.opt.railalign == "left") ? 0 : 1;
  683. self.rail = rail;
  684. self.rail.drag = false;
  685. var zoom = false;
  686. if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
  687. zoom = document.createElement('div');
  688. self.bind(zoom, "click", self.doZoom);
  689. self.bind(zoom, "mouseenter", function() {
  690. self.zoom.css('opacity', self.opt.cursoropacitymax);
  691. });
  692. self.bind(zoom, "mouseleave", function() {
  693. self.zoom.css('opacity', self.opt.cursoropacitymin);
  694. });
  695. self.zoom = $(zoom);
  696. self.zoom.css({
  697. "cursor": "pointer",
  698. 'z-index': self.zindex,
  699. 'backgroundImage': 'url(' + self.opt.scriptpath + 'zoomico.png)',
  700. 'height': 18,
  701. 'width': 18,
  702. 'backgroundPosition': '0px 0px'
  703. });
  704. if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
  705. if (cap.cantouch && self.opt.gesturezoom) {
  706. self.ongesturezoom = function(e) {
  707. if (e.scale > 1.5) self.doZoomIn(e);
  708. if (e.scale < 0.8) self.doZoomOut(e);
  709. return self.cancelEvent(e);
  710. };
  711. self.bind(self.win, "gestureend", self.ongesturezoom);
  712. }
  713. }
  714. // init HORIZ
  715. self.railh = false;
  716. var railh;
  717. if (self.opt.horizrailenabled) {
  718. self.css(cont, {
  719. 'overflow-x': 'hidden'
  720. });
  721. var cursor = $(document.createElement('div'));
  722. cursor.css({
  723. position: "absolute",
  724. top: 0,
  725. height: self.opt.cursorwidth,
  726. width: "0px",
  727. 'background-color': self.opt.cursorcolor,
  728. border: self.opt.cursorborder,
  729. 'background-clip': 'padding-box',
  730. '-webkit-border-radius': self.opt.cursorborderradius,
  731. '-moz-border-radius': self.opt.cursorborderradius,
  732. 'border-radius': self.opt.cursorborderradius
  733. });
  734. if (cap.isieold) cursor.css({'overflow':'hidden'}); //IE6 horiz scrollbar issue
  735. cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
  736. cursor.addClass('nicescroll-cursors');
  737. self.cursorh = cursor;
  738. railh = $(document.createElement('div'));
  739. railh.attr('id', self.id + '-hr');
  740. railh.addClass('nicescroll-rails nicescroll-rails-hr');
  741. railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
  742. railh.css({
  743. height: railh.height + "px",
  744. 'zIndex': self.zindex,
  745. "background": self.opt.background
  746. });
  747. railh.append(cursor);
  748. railh.visibility = true;
  749. railh.scrollable = true;
  750. railh.align = (self.opt.railvalign == "top") ? 0 : 1;
  751. self.railh = railh;
  752. self.railh.drag = false;
  753. }
  754. //
  755. if (self.ispage) {
  756. rail.css({
  757. position: "fixed",
  758. top: "0px",
  759. height: "100%"
  760. });
  761. (rail.align) ? rail.css({
  762. right: "0px"
  763. }): rail.css({
  764. left: "0px"
  765. });
  766. self.body.append(rail);
  767. if (self.railh) {
  768. railh.css({
  769. position: "fixed",
  770. left: "0px",
  771. width: "100%"
  772. });
  773. (railh.align) ? railh.css({
  774. bottom: "0px"
  775. }): railh.css({
  776. top: "0px"
  777. });
  778. self.body.append(railh);
  779. }
  780. } else {
  781. if (self.ishwscroll) {
  782. if (self.win.css('position') == 'static') self.css(self.win, {
  783. 'position': 'relative'
  784. });
  785. var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
  786. $(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
  787. if (self.zoom) {
  788. self.zoom.css({
  789. position: "absolute",
  790. top: 1,
  791. right: 0,
  792. "margin-right": rail.width + 4
  793. });
  794. bd.append(self.zoom);
  795. }
  796. rail.css({
  797. position: "absolute",
  798. top: 0
  799. });
  800. (rail.align) ? rail.css({
  801. right: 0
  802. }): rail.css({
  803. left: 0
  804. });
  805. bd.append(rail);
  806. if (railh) {
  807. railh.css({
  808. position: "absolute",
  809. left: 0,
  810. bottom: 0
  811. });
  812. (railh.align) ? railh.css({
  813. bottom: 0
  814. }): railh.css({
  815. top: 0
  816. });
  817. bd.append(railh);
  818. }
  819. } else {
  820. self.isfixed = (self.win.css("position") == "fixed");
  821. var rlpos = (self.isfixed) ? "fixed" : "absolute";
  822. if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
  823. if (self.viewport) {
  824. self.body = self.viewport;
  825. if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
  826. "position": "relative"
  827. });
  828. }
  829. rail.css({
  830. position: rlpos
  831. });
  832. if (self.zoom) self.zoom.css({
  833. position: rlpos
  834. });
  835. self.updateScrollBar();
  836. self.body.append(rail);
  837. if (self.zoom) self.body.append(self.zoom);
  838. if (self.railh) {
  839. railh.css({
  840. position: rlpos
  841. });
  842. self.body.append(railh);
  843. }
  844. }
  845. if (cap.isios) self.css(self.win, {
  846. '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
  847. '-webkit-touch-callout': 'none'
  848. }); // prevent grey layer on click
  849. if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
  850. if (cap.iswebkit && self.opt.disableoutline) self.win.css({"outline": "none"}); // Webkit outline
  851. //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO]
  852. }
  853. if (self.opt.autohidemode === false) {
  854. self.autohidedom = false;
  855. self.rail.css({
  856. opacity: self.opt.cursoropacitymax
  857. });
  858. if (self.railh) self.railh.css({
  859. opacity: self.opt.cursoropacitymax
  860. });
  861. } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
  862. self.autohidedom = $().add(self.rail);
  863. if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
  864. if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
  865. if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
  866. } else if (self.opt.autohidemode == "scroll") {
  867. self.autohidedom = $().add(self.rail);
  868. if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
  869. } else if (self.opt.autohidemode == "cursor") {
  870. self.autohidedom = $().add(self.cursor);
  871. if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
  872. } else if (self.opt.autohidemode == "hidden") {
  873. self.autohidedom = false;
  874. self.hide();
  875. self.railslocked = false;
  876. }
  877. if (cap.isie9mobile) {
  878. self.scrollmom = new ScrollMomentumClass2D(self);
  879. self.onmangotouch = function() {
  880. var py = self.getScrollTop();
  881. var px = self.getScrollLeft();
  882. if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
  883. var dfy = py - self.mangotouch.sy;
  884. var dfx = px - self.mangotouch.sx;
  885. var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
  886. if (df == 0) return;
  887. var dry = (dfy < 0) ? -1 : 1;
  888. var drx = (dfx < 0) ? -1 : 1;
  889. var tm = +new Date();
  890. if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
  891. if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
  892. self.scrollmom.stop();
  893. self.scrollmom.reset(px, py);
  894. self.mangotouch.sy = py;
  895. self.mangotouch.ly = py;
  896. self.mangotouch.sx = px;
  897. self.mangotouch.lx = px;
  898. self.mangotouch.dry = dry;
  899. self.mangotouch.drx = drx;
  900. self.mangotouch.tm = tm;
  901. } else {
  902. self.scrollmom.stop();
  903. self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
  904. self.mangotouch.tm = tm;
  905. var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
  906. self.mangotouch.ly = py;
  907. self.mangotouch.lx = px;
  908. if (ds > 2) {
  909. self.mangotouch.lazy = setTimeout(function() {
  910. self.mangotouch.lazy = false;
  911. self.mangotouch.dry = 0;
  912. self.mangotouch.drx = 0;
  913. self.mangotouch.tm = 0;
  914. self.scrollmom.doMomentum(30);
  915. }, 100);
  916. }
  917. }
  918. };
  919. var top = self.getScrollTop();
  920. var lef = self.getScrollLeft();
  921. self.mangotouch = {
  922. sy: top,
  923. ly: top,
  924. dry: 0,
  925. sx: lef,
  926. lx: lef,
  927. drx: 0,
  928. lazy: false,
  929. tm: 0
  930. };
  931. self.bind(self.docscroll, "scroll", self.onmangotouch);
  932. } else {
  933. if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
  934. self.scrollmom = new ScrollMomentumClass2D(self);
  935. self.ontouchstart = function(e) {
  936. if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
  937. self.hasmoving = false;
  938. if (!self.railslocked) {
  939. var tg;
  940. if (cap.hasmstouch) {
  941. tg = (e.target) ? e.target : false;
  942. while (tg) {
  943. var nc = $(tg).getNiceScroll();
  944. if ((nc.length > 0) && (nc[0].me == self.me)) break;
  945. if (nc.length > 0) return false;
  946. if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
  947. tg = (tg.parentNode) ? tg.parentNode : false;
  948. }
  949. }
  950. self.cancelScroll();
  951. tg = self.getTarget(e);
  952. if (tg) {
  953. var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
  954. if (skp) return self.stopPropagation(e);
  955. }
  956. if (!("clientX" in e) && ("changedTouches" in e)) {
  957. e.clientX = e.changedTouches[0].clientX;
  958. e.clientY = e.changedTouches[0].clientY;
  959. }
  960. if (self.forcescreen) {
  961. var le = e;
  962. e = {
  963. "original": (e.original) ? e.original : e
  964. };
  965. e.clientX = le.screenX;
  966. e.clientY = le.screenY;
  967. }
  968. self.rail.drag = {
  969. x: e.clientX,
  970. y: e.clientY,
  971. sx: self.scroll.x,
  972. sy: self.scroll.y,
  973. st: self.getScrollTop(),
  974. sl: self.getScrollLeft(),
  975. pt: 2,
  976. dl: false
  977. };
  978. if (self.ispage || !self.opt.directionlockdeadzone) {
  979. self.rail.drag.dl = "f";
  980. } else {
  981. var view = {
  982. w: $(window).width(),
  983. h: $(window).height()
  984. };
  985. var page = {
  986. w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
  987. h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
  988. };
  989. var maxh = Math.max(0, page.h - view.h);
  990. var maxw = Math.max(0, page.w - view.w);
  991. if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
  992. else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
  993. else self.rail.drag.ck = false;
  994. if (!self.rail.drag.ck) self.rail.drag.dl = "f";
  995. }
  996. if (self.opt.touchbehavior && self.isiframe && cap.isie) {
  997. var wp = self.win.position();
  998. self.rail.drag.x += wp.left;
  999. self.rail.drag.y += wp.top;
  1000. }
  1001. self.hasmoving = false;
  1002. self.lastmouseup = false;
  1003. self.scrollmom.reset(e.clientX, e.clientY);
  1004. if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
  1005. var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
  1006. if (!ip) {
  1007. if (!self.ispage && cap.hasmousecapture) tg.setCapture();
  1008. if (self.opt.touchbehavior) {
  1009. if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
  1010. tg._onclick = tg.onclick;
  1011. tg.onclick = function(e) {
  1012. if (self.hasmoving) return false;
  1013. tg._onclick.call(this, e);
  1014. };
  1015. }
  1016. return self.cancelEvent(e);
  1017. }
  1018. return self.stopPropagation(e);
  1019. }
  1020. if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
  1021. pc = {
  1022. "tg": tg,
  1023. "click": false
  1024. };
  1025. self.preventclick = pc;
  1026. }
  1027. }
  1028. }
  1029. };
  1030. self.ontouchend = function(e) {
  1031. if (!self.rail.drag) return true;
  1032. if (self.rail.drag.pt == 2) {
  1033. if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
  1034. self.scrollmom.doMomentum();
  1035. self.rail.drag = false;
  1036. if (self.hasmoving) {
  1037. self.lastmouseup = true;
  1038. self.hideCursor();
  1039. if (cap.hasmousecapture) document.releaseCapture();
  1040. if (!cap.cantouch) return self.cancelEvent(e);
  1041. }
  1042. }
  1043. else if (self.rail.drag.pt == 1) {
  1044. return self.onmouseup(e);
  1045. }
  1046. };
  1047. var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
  1048. self.ontouchmove = function(e, byiframe) {
  1049. if (!self.rail.drag) return false;
  1050. if (e.targetTouches && self.opt.preventmultitouchscrolling) {
  1051. if (e.targetTouches.length > 1) return false; // multitouch
  1052. }
  1053. if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
  1054. if (self.rail.drag.pt == 2) {
  1055. if (cap.cantouch && (cap.isios) && (typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
  1056. self.hasmoving = true;
  1057. if (self.preventclick && !self.preventclick.click) {
  1058. self.preventclick.click = self.preventclick.tg.onclick || false;
  1059. self.preventclick.tg.onclick = self.onpreventclick;
  1060. }
  1061. var ev = $.extend({
  1062. "original": e
  1063. }, e);
  1064. e = ev;
  1065. if (("changedTouches" in e)) {
  1066. e.clientX = e.changedTouches[0].clientX;
  1067. e.clientY = e.changedTouches[0].clientY;
  1068. }
  1069. if (self.forcescreen) {
  1070. var le = e;
  1071. e = {
  1072. "original": (e.original) ? e.original : e
  1073. };
  1074. e.clientX = le.screenX;
  1075. e.clientY = le.screenY;
  1076. }
  1077. var ofy,ofx;
  1078. ofx = ofy = 0;
  1079. if (moveneedoffset && !byiframe) {
  1080. var wp = self.win.position();
  1081. ofx = -wp.left;
  1082. ofy = -wp.top;
  1083. }
  1084. var fy = e.clientY + ofy;
  1085. var my = (fy - self.rail.drag.y);
  1086. var fx = e.clientX + ofx;
  1087. var mx = (fx - self.rail.drag.x);
  1088. var ny = self.rail.drag.st - my;
  1089. if (self.ishwscroll && self.opt.bouncescroll) {
  1090. if (ny < 0) {
  1091. ny = Math.round(ny / 2);
  1092. // fy = 0;
  1093. } else if (ny > self.page.maxh) {
  1094. ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
  1095. // fy = 0;
  1096. }
  1097. } else {
  1098. if (ny < 0) {
  1099. ny = 0;
  1100. fy = 0;
  1101. }
  1102. if (ny > self.page.maxh) {
  1103. ny = self.page.maxh;
  1104. fy = 0;
  1105. }
  1106. }
  1107. var nx;
  1108. if (self.railh && self.railh.scrollable) {
  1109. nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
  1110. if (self.ishwscroll && self.opt.bouncescroll) {
  1111. if (nx < 0) {
  1112. nx = Math.round(nx / 2);
  1113. // fx = 0;
  1114. } else if (nx > self.page.maxw) {
  1115. nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
  1116. // fx = 0;
  1117. }
  1118. } else {
  1119. if (nx < 0) {
  1120. nx = 0;
  1121. fx = 0;
  1122. }
  1123. if (nx > self.page.maxw) {
  1124. nx = self.page.maxw;
  1125. fx = 0;
  1126. }
  1127. }
  1128. }
  1129. var grabbed = false;
  1130. if (self.rail.drag.dl) {
  1131. grabbed = true;
  1132. if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
  1133. else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
  1134. } else {
  1135. var ay = Math.abs(my);
  1136. var ax = Math.abs(mx);
  1137. var dz = self.opt.directionlockdeadzone;
  1138. if (self.rail.drag.ck == "v") {
  1139. if (ay > dz && (ax <= (ay * 0.3))) {
  1140. self.rail.drag = false;
  1141. return true;
  1142. } else if (ax > dz) {
  1143. self.rail.drag.dl = "f";
  1144. $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
  1145. }
  1146. } else if (self.rail.drag.ck == "h") {
  1147. if (ax > dz && (ay <= (ax * 0.3))) {
  1148. self.rail.drag = false;
  1149. return true;
  1150. } else if (ay > dz) {
  1151. self.rail.drag.dl = "f";
  1152. $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
  1153. }
  1154. }
  1155. }
  1156. self.synched("touchmove", function() {
  1157. if (self.rail.drag && (self.rail.drag.pt == 2)) {
  1158. if (self.prepareTransition) self.prepareTransition(0);
  1159. if (self.rail.scrollable) self.setScrollTop(ny);
  1160. self.scrollmom.update(fx, fy);
  1161. if (self.railh && self.railh.scrollable) {
  1162. self.setScrollLeft(nx);
  1163. self.showCursor(ny, nx);
  1164. } else {
  1165. self.showCursor(ny);
  1166. }
  1167. if (cap.isie10) document.selection.clear();
  1168. }
  1169. });
  1170. if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
  1171. if (grabbed) return self.cancelEvent(e);
  1172. }
  1173. else if (self.rail.drag.pt == 1) { // drag on cursor
  1174. return self.onmousemove(e);
  1175. }
  1176. };
  1177. }
  1178. self.onmousedown = function(e, hronly) {
  1179. if (self.rail.drag && self.rail.drag.pt != 1) return;
  1180. if (self.railslocked) return self.cancelEvent(e);
  1181. self.cancelScroll();
  1182. self.rail.drag = {
  1183. x: e.clientX,
  1184. y: e.clientY,
  1185. sx: self.scroll.x,
  1186. sy: self.scroll.y,
  1187. pt: 1,
  1188. hr: (!!hronly)
  1189. };
  1190. var tg = self.getTarget(e);
  1191. if (!self.ispage && cap.hasmousecapture) tg.setCapture();
  1192. if (self.isiframe && !cap.hasmousecapture) {
  1193. self.saved.csspointerevents = self.doc.css("pointer-events");
  1194. self.css(self.doc, {
  1195. "pointer-events": "none"
  1196. });
  1197. }
  1198. self.hasmoving = false;
  1199. return self.cancelEvent(e);
  1200. };
  1201. self.onmouseup = function(e) {
  1202. if (self.rail.drag) {
  1203. if (self.rail.drag.pt != 1) return true;
  1204. if (cap.hasmousecapture) document.releaseCapture();
  1205. if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
  1206. self.rail.drag = false;
  1207. //if (!self.rail.active) self.hideCursor();
  1208. if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
  1209. return self.cancelEvent(e);
  1210. }
  1211. };
  1212. self.onmousemove = function(e) {
  1213. if (self.rail.drag) {
  1214. if (self.rail.drag.pt != 1) return;
  1215. if (cap.ischrome && e.which == 0) return self.onmouseup(e);
  1216. self.cursorfreezed = true;
  1217. self.hasmoving = true;
  1218. if (self.rail.drag.hr) {
  1219. self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
  1220. if (self.scroll.x < 0) self.scroll.x = 0;
  1221. var mw = self.scrollvaluemaxw;
  1222. if (self.scroll.x > mw) self.scroll.x = mw;
  1223. } else {
  1224. self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
  1225. if (self.scroll.y < 0) self.scroll.y = 0;
  1226. var my = self.scrollvaluemax;
  1227. if (self.scroll.y > my) self.scroll.y = my;
  1228. }
  1229. self.synched('mousemove', function() {
  1230. if (self.rail.drag && (self.rail.drag.pt == 1)) {
  1231. self.showCursor();
  1232. if (self.rail.drag.hr) {
  1233. if (self.hasreversehr) {
  1234. self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
  1235. } else {
  1236. self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
  1237. }
  1238. }
  1239. else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
  1240. }
  1241. });
  1242. return self.cancelEvent(e);
  1243. }
  1244. /*
  1245. else {
  1246. self.checkarea = true;
  1247. }
  1248. */
  1249. };
  1250. if (cap.cantouch || self.opt.touchbehavior) {
  1251. self.onpreventclick = function(e) {
  1252. if (self.preventclick) {
  1253. self.preventclick.tg.onclick = self.preventclick.click;
  1254. self.preventclick = false;
  1255. return self.cancelEvent(e);
  1256. }
  1257. }
  1258. self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
  1259. self.onclick = (cap.isios) ? false : function(e) {
  1260. if (self.lastmouseup) {
  1261. self.lastmouseup = false;
  1262. return self.cancelEvent(e);
  1263. } else {
  1264. return true;
  1265. }
  1266. };
  1267. if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
  1268. self.css((self.ispage) ? self.doc : self.win, {
  1269. 'cursor': cap.cursorgrabvalue
  1270. });
  1271. self.css(self.rail, {
  1272. 'cursor': cap.cursorgrabvalue
  1273. });
  1274. }
  1275. } else {
  1276. var checkSelectionScroll = function(e) {
  1277. if (!self.selectiondrag) return;
  1278. if (e) {
  1279. var ww = self.win.outerHeight();
  1280. var df = (e.pageY - self.selectiondrag.top);
  1281. if (df > 0 && df < ww) df = 0;
  1282. if (df >= ww) df -= ww;
  1283. self.selectiondrag.df = df;
  1284. }
  1285. if (self.selectiondrag.df == 0) return;
  1286. var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
  1287. self.doScrollBy(rt);
  1288. self.debounced("doselectionscroll", function() {
  1289. checkSelectionScroll()
  1290. }, 50);
  1291. };
  1292. if ("getSelection" in document) { // A grade - Major browsers
  1293. self.hasTextSelected = function() {
  1294. return (document.getSelection().rangeCount > 0);
  1295. };
  1296. } else if ("selection" in document) { //IE9-
  1297. self.hasTextSelected = function() {
  1298. return (document.selection.type != "None");
  1299. };
  1300. } else {
  1301. self.hasTextSelected = function() { // no support
  1302. return false;
  1303. };
  1304. }
  1305. self.onselectionstart = function(e) {
  1306. /* More testing - severe chrome issues
  1307. if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
  1308. self.win.css({'overflow':'auto'});
  1309. setTimeout(function(){
  1310. self.win.css({'overflow':''});
  1311. },10);
  1312. return true;
  1313. }
  1314. */
  1315. if (self.ispage) return;
  1316. self.selectiondrag = self.win.offset();
  1317. };
  1318. self.onselectionend = function(e) {
  1319. self.selectiondrag = false;
  1320. };
  1321. self.onselectiondrag = function(e) {
  1322. if (!self.selectiondrag) return;
  1323. if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
  1324. checkSelectionScroll(e)
  1325. }, 250);
  1326. };
  1327. }
  1328. if (cap.hasw3ctouch) { //IE11+
  1329. self.css(self.rail, {
  1330. 'touch-action': 'none'
  1331. });
  1332. self.css(self.cursor, {
  1333. 'touch-action': 'none'
  1334. });
  1335. self.bind(self.win, "pointerdown", self.ontouchstart);
  1336. self.bind(document, "pointerup", self.ontouchend);
  1337. self.bind(document, "pointermove", self.ontouchmove);
  1338. } else if (cap.hasmstouch) { //IE10
  1339. self.css(self.rail, {
  1340. '-ms-touch-action': 'none'
  1341. });
  1342. self.css(self.cursor, {
  1343. '-ms-touch-action': 'none'
  1344. });
  1345. self.bind(self.win, "MSPointerDown", self.ontouchstart);
  1346. self.bind(document, "MSPointerUp", self.ontouchend);
  1347. self.bind(document, "MSPointerMove", self.ontouchmove);
  1348. self.bind(self.cursor, "MSGestureHold", function(e) {
  1349. e.preventDefault()
  1350. });
  1351. self.bind(self.cursor, "contextmenu", function(e) {
  1352. e.preventDefault()
  1353. });
  1354. } else if (this.istouchcapable) { //desktop with screen touch enabled
  1355. self.bind(self.win, "touchstart", self.ontouchstart);
  1356. self.bind(document, "touchend", self.ontouchend);
  1357. self.bind(document, "touchcancel", self.ontouchend);
  1358. self.bind(document, "touchmove", self.ontouchmove);
  1359. }
  1360. if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
  1361. self.rail.css({
  1362. "cursor": "default"
  1363. });
  1364. self.railh && self.railh.css({
  1365. "cursor": "default"
  1366. });
  1367. self.jqbind(self.rail, "mouseenter", function() {
  1368. if (!self.ispage && !self.win.is(":visible")) return false;
  1369. if (self.canshowonmouseevent) self.showCursor();
  1370. self.rail.active = true;
  1371. });
  1372. self.jqbind(self.rail, "mouseleave", function() {
  1373. self.rail.active = false;
  1374. if (!self.rail.drag) self.hideCursor();
  1375. });
  1376. if (self.opt.sensitiverail) {
  1377. self.bind(self.rail, "click", function(e) {
  1378. self.doRailClick(e, false, false)
  1379. });
  1380. self.bind(self.rail, "dblclick", function(e) {
  1381. self.doRailClick(e, true, false)
  1382. });
  1383. self.bind(self.cursor, "click", function(e) {
  1384. self.cancelEvent(e)
  1385. });
  1386. self.bind(self.cursor, "dblclick", function(e) {
  1387. self.cancelEvent(e)
  1388. });
  1389. }
  1390. if (self.railh) {
  1391. self.jqbind(self.railh, "mouseenter", function() {
  1392. if (!self.ispage && !self.win.is(":visible")) return false;
  1393. if (self.canshowonmouseevent) self.showCursor();
  1394. self.rail.active = true;
  1395. });
  1396. self.jqbind(self.railh, "mouseleave", function() {
  1397. self.rail.active = false;
  1398. if (!self.rail.drag) self.hideCursor();
  1399. });
  1400. if (self.opt.sensitiverail) {
  1401. self.bind(self.railh, "click", function(e) {
  1402. self.doRailClick(e, false, true)
  1403. });
  1404. self.bind(self.railh, "dblclick", function(e) {
  1405. self.doRailClick(e, true, true)
  1406. });
  1407. self.bind(self.cursorh, "click", function(e) {
  1408. self.cancelEvent(e)
  1409. });
  1410. self.bind(self.cursorh, "dblclick", function(e) {
  1411. self.cancelEvent(e)
  1412. });
  1413. }
  1414. }
  1415. }
  1416. if (!cap.cantouch && !self.opt.touchbehavior) {
  1417. self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
  1418. self.bind(document, "mousemove", self.onmousemove);
  1419. if (self.onclick) self.bind(document, "click", self.onclick);
  1420. self.bind(self.cursor, "mousedown", self.onmousedown);
  1421. self.bind(self.cursor, "mouseup", self.onmouseup);
  1422. if (self.railh) {
  1423. self.bind(self.cursorh, "mousedown", function(e) {
  1424. self.onmousedown(e, true)
  1425. });
  1426. self.bind(self.cursorh, "mouseup", self.onmouseup);
  1427. }
  1428. if (!self.ispage && self.opt.enablescrollonselection) {
  1429. self.bind(self.win[0], "mousedown", self.onselectionstart);
  1430. self.bind(document, "mouseup", self.onselectionend);
  1431. self.bind(self.cursor, "mouseup", self.onselectionend);
  1432. if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
  1433. self.bind(document, "mousemove", self.onselectiondrag);
  1434. }
  1435. if (self.zoom) {
  1436. self.jqbind(self.zoom, "mouseenter", function() {
  1437. if (self.canshowonmouseevent) self.showCursor();
  1438. self.rail.active = true;
  1439. });
  1440. self.jqbind(self.zoom, "mouseleave", function() {
  1441. self.rail.active = false;
  1442. if (!self.rail.drag) self.hideCursor();
  1443. });
  1444. }
  1445. } else {
  1446. self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
  1447. self.bind(document, "mousemove", self.ontouchmove);
  1448. if (self.onclick) self.bind(document, "click", self.onclick);
  1449. if (self.opt.cursordragontouch) {
  1450. self.bind(self.cursor, "mousedown", self.onmousedown);
  1451. self.bind(self.cursor, "mouseup", self.onmouseup);
  1452. //self.bind(self.cursor, "mousemove", self.onmousemove);
  1453. self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
  1454. self.onmousedown(e, true)
  1455. });
  1456. //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
  1457. self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
  1458. }
  1459. }
  1460. if (self.opt.enablemousewheel) {
  1461. if (!self.isiframe) self.bind((cap.isie && self.ispage) ? document : self.win /*self.docscroll*/ , "mousewheel", self.onmousewheel);
  1462. self.bind(self.rail, "mousewheel", self.onmousewheel);
  1463. if (self.railh) self.bind(self.railh, "mousewheel", self.onmousewheelhr);
  1464. }
  1465. if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
  1466. if (!self.win.attr("tabindex")) self.win.attr({
  1467. "tabindex": tabindexcounter++
  1468. });
  1469. self.jqbind(self.win, "focus", function(e) {
  1470. domfocus = (self.getTarget(e)).id || true;
  1471. self.hasfocus = true;
  1472. if (self.canshowonmouseevent) self.noticeCursor();
  1473. });
  1474. self.jqbind(self.win, "blur", function(e) {
  1475. domfocus = false;
  1476. self.hasfocus = false;
  1477. });
  1478. self.jqbind(self.win, "mouseenter", function(e) {
  1479. mousefocus = (self.getTarget(e)).id || true;
  1480. self.hasmousefocus = true;
  1481. if (self.canshowonmouseevent) self.noticeCursor();
  1482. });
  1483. self.jqbind(self.win, "mouseleave", function() {
  1484. mousefocus = false;
  1485. self.hasmousefocus = false;
  1486. if (!self.rail.drag) self.hideCursor();
  1487. });
  1488. }
  1489. } // !ie9mobile
  1490. //Thanks to http://www.quirksmode.org !!
  1491. self.onkeypress = function(e) {
  1492. if (self.railslocked && self.page.maxh == 0) return true;
  1493. e = (e) ? e : window.e;
  1494. var tg = self.getTarget(e);
  1495. if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
  1496. var tp = tg.getAttribute('type') || tg.type || false;
  1497. if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
  1498. }
  1499. if ($(tg).attr('contenteditable')) return true;
  1500. if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
  1501. var key = e.keyCode;
  1502. if (self.railslocked && key != 27) return self.cancelEvent(e);
  1503. var ctrl = e.ctrlKey || false;
  1504. var shift = e.shiftKey || false;
  1505. var ret = false;
  1506. switch (key) {
  1507. case 38:
  1508. case 63233: //safari
  1509. self.doScrollBy(24 * 3);
  1510. ret = true;
  1511. break;
  1512. case 40:
  1513. case 63235: //safari
  1514. self.doScrollBy(-24 * 3);
  1515. ret = true;
  1516. break;
  1517. case 37:
  1518. case 63232: //safari
  1519. if (self.railh) {
  1520. (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
  1521. ret = true;
  1522. }
  1523. break;
  1524. case 39:
  1525. case 63234: //safari
  1526. if (self.railh) {
  1527. (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
  1528. ret = true;
  1529. }
  1530. break;
  1531. case 33:
  1532. case 63276: // safari
  1533. self.doScrollBy(self.view.h);
  1534. ret = true;
  1535. break;
  1536. case 34:
  1537. case 63277: // safari
  1538. self.doScrollBy(-self.view.h);
  1539. ret = true;
  1540. break;
  1541. case 36:
  1542. case 63273: // safari
  1543. (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
  1544. ret = true;
  1545. break;
  1546. case 35:
  1547. case 63275: // safari
  1548. (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
  1549. ret = true;
  1550. break;
  1551. case 32:
  1552. if (self.opt.spacebarenabled) {
  1553. (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
  1554. ret = true;
  1555. }
  1556. break;
  1557. case 27: // ESC
  1558. if (self.zoomactive) {
  1559. self.doZoom();
  1560. ret = true;
  1561. }
  1562. break;
  1563. }
  1564. if (ret) return self.cancelEvent(e);
  1565. }
  1566. };
  1567. if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
  1568. self.bind(document, "keydown", function(e) {
  1569. var ctrl = e.ctrlKey || false;
  1570. if (ctrl) self.wheelprevented = true;
  1571. });
  1572. self.bind(document, "keyup", function(e) {
  1573. var ctrl = e.ctrlKey || false;
  1574. if (!ctrl) self.wheelprevented = false;
  1575. });
  1576. self.bind(window,"blur",function(e){
  1577. self.wheelprevented = false;
  1578. });
  1579. self.bind(window, 'resize', self.lazyResize);
  1580. self.bind(window, 'orientationchange', self.lazyResize);
  1581. self.bind(window, "load", self.lazyResize);
  1582. if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
  1583. var tmp = self.win.attr("style");
  1584. var ww = parseFloat(self.win.css("width")) + 1;
  1585. self.win.css('width', ww);
  1586. self.synched("chromefix", function() {
  1587. self.win.attr("style", tmp)
  1588. });
  1589. }
  1590. // Trying a cross-browser implementation - good luck!
  1591. self.onAttributeChange = function(e) {
  1592. self.lazyResize(self.isieold ? 250 : 30);
  1593. };
  1594. if (ClsMutationObserver !== false) {
  1595. self.observerbody = new ClsMutationObserver(function(mutations) {
  1596. mutations.forEach(function(mut){
  1597. if (mut.type=="attributes") {
  1598. return ($("body").hasClass("modal-open")) ? self.hide() : self.show(); // Support for Bootstrap modal
  1599. }
  1600. });
  1601. if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
  1602. });
  1603. self.observerbody.observe(document.body, {
  1604. childList: true,
  1605. subtree: true,
  1606. characterData: false,
  1607. attributes: true,
  1608. attributeFilter: ['class']
  1609. });
  1610. }
  1611. if (!self.ispage && !self.haswrapper) {
  1612. // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
  1613. if (ClsMutationObserver !== false) {
  1614. self.observer = new ClsMutationObserver(function(mutations) {
  1615. mutations.forEach(self.onAttributeChange);
  1616. });
  1617. self.observer.observe(self.win[0], {
  1618. childList: true,
  1619. characterData: false,
  1620. attributes: true,
  1621. subtree: false
  1622. });
  1623. self.observerremover = new ClsMutationObserver(function(mutations) {
  1624. mutations.forEach(function(mo) {
  1625. if (mo.removedNodes.length > 0) {
  1626. for (var dd in mo.removedNodes) {
  1627. if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
  1628. }
  1629. }
  1630. });
  1631. });
  1632. self.observerremover.observe(self.win[0].parentNode, {
  1633. childList: true,
  1634. characterData: false,
  1635. attributes: false,
  1636. subtree: false
  1637. });
  1638. } else {
  1639. self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
  1640. if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
  1641. self.bind(self.win, "DOMNodeRemoved", function(e) {
  1642. if (e.target == self.win[0]) self.remove();
  1643. });
  1644. }
  1645. }
  1646. //
  1647. if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
  1648. if (self.istextarea) self.bind(self.win, "mouseup", self.lazyResize);
  1649. // self.checkrtlmode = true;
  1650. self.lazyResize(30);
  1651. }
  1652. if (this.doc[0].nodeName == 'IFRAME') {
  1653. var oniframeload = function() {
  1654. self.iframexd = false;
  1655. var doc;
  1656. try {
  1657. doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
  1658. var a = doc.domain;
  1659. } catch (e) {
  1660. self.iframexd = true;
  1661. doc = false
  1662. }
  1663. if (self.iframexd) {
  1664. if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
  1665. return true; //cross-domain - I can't manage this
  1666. }
  1667. self.forcescreen = true;
  1668. if (self.isiframe) {
  1669. self.iframe = {
  1670. "doc": $(doc),
  1671. "html": self.doc.contents().find('html')[0],
  1672. "body": self.doc.contents().find('body')[0]
  1673. };
  1674. self.getContentSize = function() {
  1675. return {
  1676. w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
  1677. h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
  1678. };
  1679. };
  1680. self.docscroll = $(self.iframe.body); //$(this.contentWindow);
  1681. }
  1682. if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
  1683. self.win.scrollTop(0); // reset position
  1684. self.doc.height(""); //reset height to fix browser bug
  1685. var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
  1686. self.doc.height(hh);
  1687. }
  1688. self.lazyResize(30);
  1689. if (cap.isie7) self.css($(self.iframe.html), {
  1690. 'overflow-y': 'hidden'
  1691. });
  1692. self.css($(self.iframe.body), {
  1693. 'overflow-y': 'hidden'
  1694. });
  1695. if (cap.isios && self.haswrapper) {
  1696. self.css($(doc.body), {
  1697. '-webkit-transform': 'translate3d(0,0,0)'
  1698. }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
  1699. }
  1700. if ('contentWindow' in this) {
  1701. self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
  1702. } else {
  1703. self.bind(doc, "scroll", self.onscroll);
  1704. }
  1705. if (self.opt.enablemousewheel) {
  1706. self.bind(doc, "mousewheel", self.onmousewheel);
  1707. }
  1708. if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
  1709. if (cap.cantouch || self.opt.touchbehavior) {
  1710. self.bind(doc, "mousedown", self.ontouchstart);
  1711. self.bind(doc, "mousemove", function(e) {
  1712. return self.ontouchmove(e, true)
  1713. });
  1714. if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
  1715. 'cursor': cap.cursorgrabvalue
  1716. });
  1717. }
  1718. self.bind(doc, "mouseup", self.ontouchend);
  1719. if (self.zoom) {
  1720. if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
  1721. if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
  1722. }
  1723. };
  1724. if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
  1725. setTimeout(function() {
  1726. oniframeload.call(self.doc[0], false)
  1727. }, 500);
  1728. }
  1729. self.bind(this.doc, "load", oniframeload);
  1730. }
  1731. };
  1732. this.showCursor = function(py, px) {
  1733. if (self.cursortimeout) {
  1734. clearTimeout(self.cursortimeout);
  1735. self.cursortimeout = 0;
  1736. }
  1737. if (!self.rail) return;
  1738. if (self.autohidedom) {
  1739. self.autohidedom.stop().css({
  1740. opacity: self.opt.cursoropacitymax
  1741. });
  1742. self.cursoractive = true;
  1743. }
  1744. if (!self.rail.drag || self.rail.drag.pt != 1) {
  1745. if ((typeof py != "undefined") && (py !== false)) {
  1746. self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
  1747. }
  1748. if (typeof px != "undefined") {
  1749. self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
  1750. }
  1751. }
  1752. self.cursor.css({
  1753. height: self.cursorheight,
  1754. top: self.scroll.y
  1755. });
  1756. if (self.cursorh) {
  1757. var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
  1758. (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
  1759. width: self.cursorwidth,
  1760. left: lx + self.rail.width
  1761. }): self.cursorh.css({
  1762. width: self.cursorwidth,
  1763. left: lx
  1764. });
  1765. self.cursoractive = true;
  1766. }
  1767. if (self.zoom) self.zoom.stop().css({
  1768. opacity: self.opt.cursoropacitymax
  1769. });
  1770. };
  1771. this.hideCursor = function(tm) {
  1772. if (self.cursortimeout) return;
  1773. if (!self.rail) return;
  1774. if (!self.autohidedom) return;
  1775. if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
  1776. self.cursortimeout = setTimeout(function() {
  1777. if (!self.rail.active || !self.showonmouseevent) {
  1778. self.autohidedom.stop().animate({
  1779. opacity: self.opt.cursoropacitymin
  1780. });
  1781. if (self.zoom) self.zoom.stop().animate({
  1782. opacity: self.opt.cursoropacitymin
  1783. });
  1784. self.cursoractive = false;
  1785. }
  1786. self.cursortimeout = 0;
  1787. }, tm || self.opt.hidecursordelay);
  1788. };
  1789. this.noticeCursor = function(tm, py, px) {
  1790. self.showCursor(py, px);
  1791. if (!self.rail.active) self.hideCursor(tm);
  1792. };
  1793. this.getContentSize =
  1794. (self.ispage) ?
  1795. function() {
  1796. return {
  1797. w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
  1798. h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
  1799. }
  1800. } : (self.haswrapper) ?
  1801. function() {
  1802. return {
  1803. w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
  1804. h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
  1805. }
  1806. } : function() {
  1807. return {
  1808. w: self.docscroll[0].scrollWidth,
  1809. h: self.docscroll[0].scrollHeight
  1810. }
  1811. };
  1812. this.onResize = function(e, page) {
  1813. if (!self || !self.win) return false;
  1814. if (!self.haswrapper && !self.ispage) {
  1815. if (self.win.css('display') == 'none') {
  1816. if (self.visibility) self.hideRail().hideRailHr();
  1817. return false;
  1818. } else {
  1819. if (!self.hidden && !self.visibility) self.showRail().showRailHr();
  1820. }
  1821. }
  1822. var premaxh = self.page.maxh;
  1823. var premaxw = self.page.maxw;
  1824. var preview = {
  1825. h: self.view.h,
  1826. w: self.view.w
  1827. };
  1828. self.view = {
  1829. w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
  1830. h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
  1831. };
  1832. self.page = (page) ? page : self.getContentSize();
  1833. self.page.maxh = Math.max(0, self.page.h - self.view.h);
  1834. self.page.maxw = Math.max(0, self.page.w - self.view.w);
  1835. if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
  1836. // test position
  1837. if (!self.ispage) {
  1838. var pos = self.win.offset();
  1839. if (self.lastposition) {
  1840. var lst = self.lastposition;
  1841. if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
  1842. }
  1843. self.lastposition = pos;
  1844. } else {
  1845. return self; //nothing to do
  1846. }
  1847. }
  1848. if (self.page.maxh == 0) {
  1849. self.hideRail();
  1850. self.scrollvaluemax = 0;
  1851. self.scroll.y = 0;
  1852. self.scrollratio.y = 0;
  1853. self.cursorheight = 0;
  1854. self.setScrollTop(0);
  1855. self.rail.scrollable = false;
  1856. } else {
  1857. self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
  1858. self.rail.scrollable = true;
  1859. }
  1860. if (self.page.maxw == 0) {
  1861. self.hideRailHr();
  1862. self.scrollvaluemaxw = 0;
  1863. self.scroll.x = 0;
  1864. self.scrollratio.x = 0;
  1865. self.cursorwidth = 0;
  1866. self.setScrollLeft(0);
  1867. self.railh.scrollable = false;
  1868. } else {
  1869. self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //**
  1870. self.railh.scrollable = true;
  1871. }
  1872. self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
  1873. if (self.railslocked) {
  1874. if (!self.ispage) self.updateScrollBar(self.view);
  1875. return false;
  1876. }
  1877. if (!self.hidden && !self.visibility) {
  1878. self.showRail().showRailHr();
  1879. }
  1880. else if (!self.hidden && !self.railh.visibility) self.showRailHr();
  1881. if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
  1882. self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
  1883. self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
  1884. self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
  1885. self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
  1886. self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
  1887. if (self.railh) {
  1888. self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
  1889. self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //**
  1890. }
  1891. /*
  1892. if (self.checkrtlmode&&self.railh) {
  1893. self.checkrtlmode = false;
  1894. if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
  1895. }
  1896. */
  1897. if (!self.ispage) self.updateScrollBar(self.view);
  1898. self.scrollratio = {
  1899. x: (self.page.maxw / self.scrollvaluemaxw),
  1900. y: (self.page.maxh / self.scrollvaluemax)
  1901. };
  1902. var sy = self.getScrollTop();
  1903. if (sy > self.page.maxh) {
  1904. self.doScrollTop(self.page.maxh);
  1905. } else {
  1906. self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
  1907. self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
  1908. if (self.cursoractive) self.noticeCursor();
  1909. }
  1910. if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
  1911. return self;
  1912. };
  1913. this.resize = self.onResize;
  1914. this.lazyResize = function(tm) { // event debounce
  1915. tm = (isNaN(tm)) ? 30 : tm;
  1916. self.debounced('resize', self.resize, tm);
  1917. return self;
  1918. };
  1919. // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
  1920. function _modernWheelEvent(dom, name, fn, bubble) {
  1921. self._bind(dom, name, function(e) {
  1922. var e = (e) ? e : window.event;
  1923. var event = {
  1924. original: e,
  1925. target: e.target || e.srcElement,
  1926. type: "wheel",
  1927. deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
  1928. deltaX: 0,
  1929. deltaZ: 0,
  1930. preventDefault: function() {
  1931. e.preventDefault ? e.preventDefault() : e.returnValue = false;
  1932. return false;
  1933. },
  1934. stopImmediatePropagation: function() {
  1935. (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
  1936. }
  1937. };
  1938. if (name == "mousewheel") {
  1939. event.deltaY = -1 / 40 * e.wheelDelta;
  1940. e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
  1941. } else {
  1942. event.deltaY = e.detail;
  1943. }
  1944. return fn.call(dom, event);
  1945. }, bubble);
  1946. };
  1947. this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
  1948. self.events.push({
  1949. e: dom,
  1950. n: name,
  1951. f: fn,
  1952. q: true
  1953. });
  1954. $(dom).bind(name, fn);
  1955. };
  1956. this.bind = function(dom, name, fn, bubble) { // touch-oriented & fixing jquery bind
  1957. var el = ("jquery" in dom) ? dom[0] : dom;
  1958. if (name == 'mousewheel') {
  1959. if (window.addEventListener||'onwheel' in document) { // modern brosers & IE9 detection fix
  1960. self._bind(el, "wheel", fn, bubble || false);
  1961. } else {
  1962. var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
  1963. _modernWheelEvent(el, wname, fn, bubble || false);
  1964. if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
  1965. }
  1966. } else if (el.addEventListener) {
  1967. if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
  1968. var tt = (name == 'mousedown') ? 'touchstart' : (name == 'mouseup') ? 'touchend' : 'touchmove';
  1969. self._bind(el, tt, function(e) {
  1970. if (e.touches) {
  1971. if (e.touches.length < 2) {
  1972. var ev = (e.touches.length) ? e.touches[0] : e;
  1973. ev.original = e;
  1974. fn.call(this, ev);
  1975. }
  1976. } else if (e.changedTouches) {
  1977. var ev = e.changedTouches[0];
  1978. ev.original = e;
  1979. fn.call(this, ev);
  1980. } //blackberry
  1981. }, bubble || false);
  1982. }
  1983. self._bind(el, name, fn, bubble || false);
  1984. if (cap.cantouch && name == "mouseup") self._bind(el, "touchcancel", fn, bubble || false);
  1985. } else {
  1986. self._bind(el, name, function(e) {
  1987. e = e || window.event || false;
  1988. if (e) {
  1989. if (e.srcElement) e.target = e.srcElement;
  1990. }
  1991. if (!("pageY" in e)) {
  1992. e.pageX = e.clientX + document.documentElement.scrollLeft;
  1993. e.pageY = e.clientY + document.documentElement.scrollTop;
  1994. }
  1995. return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
  1996. });
  1997. }
  1998. };
  1999. if (cap.haseventlistener) { // W3C standard model
  2000. this._bind = function(el, name, fn, bubble) { // primitive bind
  2001. self.events.push({
  2002. e: el,
  2003. n: name,
  2004. f: fn,
  2005. b: bubble,
  2006. q: false
  2007. });
  2008. el.addEventListener(name, fn, bubble || false);
  2009. };
  2010. this.cancelEvent = function(e) {
  2011. if (!e) return false;
  2012. var e = (e.original) ? e.original : e;
  2013. e.preventDefault();
  2014. e.stopPropagation();
  2015. if (e.preventManipulation) e.preventManipulation(); //IE10
  2016. return false;
  2017. };
  2018. this.stopPropagation = function(e) {
  2019. if (!e) return false;
  2020. var e = (e.original) ? e.original : e;
  2021. e.stopPropagation();
  2022. return false;
  2023. };
  2024. this._unbind = function(el, name, fn, bub) { // primitive unbind
  2025. el.removeEventListener(name, fn, bub);
  2026. };
  2027. } else { // old IE model
  2028. this._bind = function(el, name, fn, bubble) { // primitive bind
  2029. self.events.push({
  2030. e: el,
  2031. n: name,
  2032. f: fn,
  2033. b: bubble,
  2034. q: false
  2035. });
  2036. if (el.attachEvent) {
  2037. el.attachEvent("on" + name, fn);
  2038. } else {
  2039. el["on" + name] = fn;
  2040. }
  2041. };
  2042. // Thanks to http://www.switchonthecode.com !!
  2043. this.cancelEvent = function(e) {
  2044. var e = window.event || false;
  2045. if (!e) return false;
  2046. e.cancelBubble = true;
  2047. e.cancel = true;
  2048. e.returnValue = false;
  2049. return false;
  2050. };
  2051. this.stopPropagation = function(e) {
  2052. var e = window.event || false;
  2053. if (!e) return false;
  2054. e.cancelBubble = true;
  2055. return false;
  2056. };
  2057. this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
  2058. if (el.detachEvent) {
  2059. el.detachEvent('on' + name, fn);
  2060. } else {
  2061. el['on' + name] = false;
  2062. }
  2063. };
  2064. }
  2065. this.unbindAll = function() {
  2066. for (var a = 0; a < self.events.length; a++) {
  2067. var r = self.events[a];
  2068. (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
  2069. }
  2070. };
  2071. this.showRail = function() {
  2072. if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
  2073. self.visibility = true;
  2074. self.rail.visibility = true;
  2075. self.rail.css('display', 'block');
  2076. }
  2077. return self;
  2078. };
  2079. this.showRailHr = function() {
  2080. if (!self.railh) return self;
  2081. if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
  2082. self.railh.visibility = true;
  2083. self.railh.css('display', 'block');
  2084. }
  2085. return self;
  2086. };
  2087. this.hideRail = function() {
  2088. self.visibility = false;
  2089. self.rail.visibility = false;
  2090. self.rail.css('display', 'none');
  2091. return self;
  2092. };
  2093. this.hideRailHr = function() {
  2094. if (!self.railh) return self;
  2095. self.railh.visibility = false;
  2096. self.railh.css('display', 'none');
  2097. return self;
  2098. };
  2099. this.show = function() {
  2100. self.hidden = false;
  2101. self.railslocked = false;
  2102. return self.showRail().showRailHr();
  2103. };
  2104. this.hide = function() {
  2105. self.hidden = true;
  2106. self.railslocked = true;
  2107. return self.hideRail().hideRailHr();
  2108. };
  2109. this.toggle = function() {
  2110. return (self.hidden) ? self.show() : self.hide();
  2111. };
  2112. this.remove = function() {
  2113. self.stop();
  2114. if (self.cursortimeout) clearTimeout(self.cursortimeout);
  2115. self.doZoomOut();
  2116. self.unbindAll();
  2117. if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
  2118. if (self.observer !== false) self.observer.disconnect();
  2119. if (self.observerremover !== false) self.observerremover.disconnect();
  2120. if (self.observerbody !== false) self.observerbody.disconnect();
  2121. self.events = null;
  2122. if (self.cursor) {
  2123. self.cursor.remove();
  2124. }
  2125. if (self.cursorh) {
  2126. self.cursorh.remove();
  2127. }
  2128. if (self.rail) {
  2129. self.rail.remove();
  2130. }
  2131. if (self.railh) {
  2132. self.railh.remove();
  2133. }
  2134. if (self.zoom) {
  2135. self.zoom.remove();
  2136. }
  2137. for (var a = 0; a < self.saved.css.length; a++) {
  2138. var d = self.saved.css[a];
  2139. d[0].css(d[1], (typeof d[2] == "undefined") ? '' : d[2]);
  2140. }
  2141. self.saved = false;
  2142. self.me.data('__nicescroll', ''); //erase all traces
  2143. // memory leak fixed by GianlucaGuarini - thanks a lot!
  2144. // remove the current nicescroll from the $.nicescroll array & normalize array
  2145. var lst = $.nicescroll;
  2146. lst.each(function(i) {
  2147. if (!this) return;
  2148. if (this.id === self.id) {
  2149. delete lst[i];
  2150. for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
  2151. lst.length--;
  2152. if (lst.length) delete lst[lst.length];
  2153. }
  2154. });
  2155. for (var i in self) {
  2156. self[i] = null;
  2157. delete self[i];
  2158. }
  2159. self = null;
  2160. };
  2161. this.scrollstart = function(fn) {
  2162. this.onscrollstart = fn;
  2163. return self;
  2164. };
  2165. this.scrollend = function(fn) {
  2166. this.onscrollend = fn;
  2167. return self;
  2168. };
  2169. this.scrollcancel = function(fn) {
  2170. this.onscrollcancel = fn;
  2171. return self;
  2172. };
  2173. this.zoomin = function(fn) {
  2174. this.onzoomin = fn;
  2175. return self;
  2176. };
  2177. this.zoomout = function(fn) {
  2178. this.onzoomout = fn;
  2179. return self;
  2180. };
  2181. this.isScrollable = function(e) {
  2182. var dom = (e.target) ? e.target : e;
  2183. if (dom.nodeName == 'OPTION') return true;
  2184. while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
  2185. var dd = $(dom);
  2186. var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
  2187. if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
  2188. dom = (dom.parentNode) ? dom.parentNode : false;
  2189. }
  2190. return false;
  2191. };
  2192. this.getViewport = function(me) {
  2193. var dom = (me && me.parentNode) ? me.parentNode : false;
  2194. while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
  2195. var dd = $(dom);
  2196. if (/fixed|absolute/.test(dd.css("position"))) return dd;
  2197. var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
  2198. if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
  2199. if (dd.getNiceScroll().length > 0) return dd;
  2200. dom = (dom.parentNode) ? dom.parentNode : false;
  2201. }
  2202. return false; //(dom) ? $(dom) : false;
  2203. };
  2204. this.triggerScrollEnd = function() {
  2205. if (!self.onscrollend) return;
  2206. var px = self.getScrollLeft();
  2207. var py = self.getScrollTop();
  2208. var info = {
  2209. "type": "scrollend",
  2210. "current": {
  2211. "x": px,
  2212. "y": py
  2213. },
  2214. "end": {
  2215. "x": px,
  2216. "y": py
  2217. }
  2218. };
  2219. self.onscrollend.call(self, info);
  2220. }
  2221. function execScrollWheel(e, hr, chkscroll) {
  2222. var px, py;
  2223. if (e.deltaMode == 0) { // PIXEL
  2224. px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
  2225. py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
  2226. } else if (e.deltaMode == 1) { // LINE
  2227. px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
  2228. py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
  2229. }
  2230. if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
  2231. px = py;
  2232. py = 0;
  2233. if (chkscroll) {
  2234. var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
  2235. if (hrend) { // preserve vertical scrolling
  2236. py = px;
  2237. px = 0;
  2238. }
  2239. }
  2240. }
  2241. if (px) {
  2242. if (self.scrollmom) {
  2243. self.scrollmom.stop()
  2244. }
  2245. self.lastdeltax += px;
  2246. self.debounced("mousewheelx", function() {
  2247. var dt = self.lastdeltax;
  2248. self.lastdeltax = 0;
  2249. if (!self.rail.drag) {
  2250. self.doScrollLeftBy(dt)
  2251. }
  2252. }, 15);
  2253. }
  2254. if (py) {
  2255. if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
  2256. if (py < 0) {
  2257. if (self.getScrollTop() >= self.page.maxh) return true;
  2258. } else {
  2259. if (self.getScrollTop() <= 0) return true;
  2260. }
  2261. }
  2262. if (self.scrollmom) {
  2263. self.scrollmom.stop()
  2264. }
  2265. self.lastdeltay += py;
  2266. self.debounced("mousewheely", function() {
  2267. var dt = self.lastdeltay;
  2268. self.lastdeltay = 0;
  2269. if (!self.rail.drag) {
  2270. self.doScrollBy(dt)
  2271. }
  2272. }, 15);
  2273. }
  2274. e.stopImmediatePropagation();
  2275. return e.preventDefault();
  2276. };
  2277. this.onmousewheel = function(e) {
  2278. if (self.wheelprevented) return;
  2279. if (self.railslocked) {
  2280. self.debounced("checkunlock", self.resize, 250);
  2281. return true;
  2282. }
  2283. if (self.rail.drag) return self.cancelEvent(e);
  2284. if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
  2285. if (self.opt.oneaxismousemode && e.deltaX == 0) {
  2286. if (!self.rail.scrollable) {
  2287. if (self.railh && self.railh.scrollable) {
  2288. return self.onmousewheelhr(e);
  2289. } else {
  2290. return true;
  2291. }
  2292. }
  2293. }
  2294. var nw = +(new Date());
  2295. var chk = false;
  2296. if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
  2297. self.nativescrollingarea = self.isScrollable(e);
  2298. chk = true;
  2299. }
  2300. self.checkarea = nw;
  2301. if (self.nativescrollingarea) return true; // this isn't my business
  2302. var ret = execScrollWheel(e, false, chk);
  2303. if (ret) self.checkarea = 0;
  2304. return ret;
  2305. };
  2306. this.onmousewheelhr = function(e) {
  2307. if (self.wheelprevented) return;
  2308. if (self.railslocked || !self.railh.scrollable) return true;
  2309. if (self.rail.drag) return self.cancelEvent(e);
  2310. var nw = +(new Date());
  2311. var chk = false;
  2312. if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
  2313. self.nativescrollingarea = self.isScrollable(e);
  2314. chk = true;
  2315. }
  2316. self.checkarea = nw;
  2317. if (self.nativescrollingarea) return true; // this isn't my business
  2318. if (self.railslocked) return self.cancelEvent(e);
  2319. return execScrollWheel(e, true, chk);
  2320. };
  2321. this.stop = function() {
  2322. self.cancelScroll();
  2323. if (self.scrollmon) self.scrollmon.stop();
  2324. self.cursorfreezed = false;
  2325. self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
  2326. self.noticeCursor();
  2327. return self;
  2328. };
  2329. this.getTransitionSpeed = function(dif) {
  2330. var sp = Math.round(self.opt.scrollspeed * 10);
  2331. var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
  2332. return (ex > 20) ? ex : 0;
  2333. };
  2334. if (!self.opt.smoothscroll) {
  2335. this.doScrollLeft = function(x, spd) { //direct
  2336. var y = self.getScrollTop();
  2337. self.doScrollPos(x, y, spd);
  2338. };
  2339. this.doScrollTop = function(y, spd) { //direct
  2340. var x = self.getScrollLeft();
  2341. self.doScrollPos(x, y, spd);
  2342. };
  2343. this.doScrollPos = function(x, y, spd) { //direct
  2344. var nx = (x > self.page.maxw) ? self.page.maxw : x;
  2345. if (nx < 0) nx = 0;
  2346. var ny = (y > self.page.maxh) ? self.page.maxh : y;
  2347. if (ny < 0) ny = 0;
  2348. self.synched('scroll', function() {
  2349. self.setScrollTop(ny);
  2350. self.setScrollLeft(nx);
  2351. });
  2352. };
  2353. this.cancelScroll = function() {}; // direct
  2354. } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
  2355. this.prepareTransition = function(dif, istime) {
  2356. var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
  2357. var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
  2358. if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
  2359. self.lasttransitionstyle = trans;
  2360. self.doc.css(cap.transitionstyle, trans);
  2361. }
  2362. return ex;
  2363. };
  2364. this.doScrollLeft = function(x, spd) { //trans
  2365. var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
  2366. self.doScrollPos(x, y, spd);
  2367. };
  2368. this.doScrollTop = function(y, spd) { //trans
  2369. var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
  2370. self.doScrollPos(x, y, spd);
  2371. };
  2372. this.doScrollPos = function(x, y, spd) { //trans
  2373. var py = self.getScrollTop();
  2374. var px = self.getScrollLeft();
  2375. if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
  2376. if (self.opt.bouncescroll == false) {
  2377. if (y < 0) y = 0;
  2378. else if (y > self.page.maxh) y = self.page.maxh;
  2379. if (x < 0) x = 0;
  2380. else if (x > self.page.maxw) x = self.page.maxw;
  2381. }
  2382. if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
  2383. self.newscrolly = y;
  2384. self.newscrollx = x;
  2385. self.newscrollspeed = spd || false;
  2386. if (self.timer) return false;
  2387. self.timer = setTimeout(function() {
  2388. var top = self.getScrollTop();
  2389. var lft = self.getScrollLeft();
  2390. var dst = {};
  2391. dst.x = x - lft;
  2392. dst.y = y - top;
  2393. dst.px = lft;
  2394. dst.py = top;
  2395. var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
  2396. var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
  2397. if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
  2398. self.prepareTransition(ms, true);
  2399. if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
  2400. if (ms > 0) {
  2401. if (!self.scrollrunning && self.onscrollstart) {
  2402. var info = {
  2403. "type": "scrollstart",
  2404. "current": {
  2405. "x": lft,
  2406. "y": top
  2407. },
  2408. "request": {
  2409. "x": x,
  2410. "y": y
  2411. },
  2412. "end": {
  2413. "x": self.newscrollx,
  2414. "y": self.newscrolly
  2415. },
  2416. "speed": ms
  2417. };
  2418. self.onscrollstart.call(self, info);
  2419. }
  2420. if (cap.transitionend) {
  2421. if (!self.scrollendtrapped) {
  2422. self.scrollendtrapped = true;
  2423. self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
  2424. }
  2425. } else {
  2426. if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
  2427. self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
  2428. }
  2429. var py = top;
  2430. var px = lft;
  2431. self.timerscroll = {
  2432. bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
  2433. bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
  2434. };
  2435. if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
  2436. self.showCursor(self.getScrollTop(), self.getScrollLeft())
  2437. }, 60);
  2438. }
  2439. self.synched("doScroll-set", function() {
  2440. self.timer = 0;
  2441. if (self.scrollendtrapped) self.scrollrunning = true;
  2442. self.setScrollTop(self.newscrolly);
  2443. self.setScrollLeft(self.newscrollx);
  2444. if (!self.scrollendtrapped) self.onScrollTransitionEnd();
  2445. });
  2446. }, 50);
  2447. };
  2448. this.cancelScroll = function() {
  2449. if (!self.scrollendtrapped) return true;
  2450. var py = self.getScrollTop();
  2451. var px = self.getScrollLeft();
  2452. self.scrollrunning = false;
  2453. if (!cap.transitionend) clearTimeout(cap.transitionend);
  2454. self.scrollendtrapped = false;
  2455. self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
  2456. self.prepareTransition(0);
  2457. self.setScrollTop(py); // fire event onscroll
  2458. if (self.railh) self.setScrollLeft(px);
  2459. if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
  2460. self.timerscroll = false;
  2461. self.cursorfreezed = false;
  2462. self.showCursor(py, px);
  2463. return self;
  2464. };
  2465. this.onScrollTransitionEnd = function() {
  2466. if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
  2467. self.scrollendtrapped = false;
  2468. self.prepareTransition(0);
  2469. if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
  2470. self.timerscroll = false;
  2471. var py = self.getScrollTop();
  2472. var px = self.getScrollLeft();
  2473. self.setScrollTop(py); // fire event onscroll
  2474. if (self.railh) self.setScrollLeft(px); // fire event onscroll left
  2475. self.noticeCursor(false, py, px);
  2476. self.cursorfreezed = false;
  2477. if (py < 0) py = 0
  2478. else if (py > self.page.maxh) py = self.page.maxh;
  2479. if (px < 0) px = 0
  2480. else if (px > self.page.maxw) px = self.page.maxw;
  2481. if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
  2482. if (self.onscrollend && self.scrollrunning) {
  2483. self.triggerScrollEnd();
  2484. }
  2485. self.scrollrunning = false;
  2486. };
  2487. } else {
  2488. this.doScrollLeft = function(x, spd) { //no-trans
  2489. var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
  2490. self.doScrollPos(x, y, spd);
  2491. };
  2492. this.doScrollTop = function(y, spd) { //no-trans
  2493. var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
  2494. self.doScrollPos(x, y, spd);
  2495. };
  2496. this.doScrollPos = function(x, y, spd) { //no-trans
  2497. var y = ((typeof y == "undefined") || (y === false)) ? self.getScrollTop(true) : y;
  2498. if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
  2499. if (self.timer) clearAnimationFrame(self.timer);
  2500. self.timer = 0;
  2501. var py = self.getScrollTop();
  2502. var px = self.getScrollLeft();
  2503. if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
  2504. self.newscrolly = y;
  2505. self.newscrollx = x;
  2506. if (!self.bouncescroll || !self.rail.visibility) {
  2507. if (self.newscrolly < 0) {
  2508. self.newscrolly = 0;
  2509. } else if (self.newscrolly > self.page.maxh) {
  2510. self.newscrolly = self.page.maxh;
  2511. }
  2512. }
  2513. if (!self.bouncescroll || !self.railh.visibility) {
  2514. if (self.newscrollx < 0) {
  2515. self.newscrollx = 0;
  2516. } else if (self.newscrollx > self.page.maxw) {
  2517. self.newscrollx = self.page.maxw;
  2518. }
  2519. }
  2520. self.dst = {};
  2521. self.dst.x = x - px;
  2522. self.dst.y = y - py;
  2523. self.dst.px = px;
  2524. self.dst.py = py;
  2525. var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
  2526. self.dst.ax = self.dst.x / dst;
  2527. self.dst.ay = self.dst.y / dst;
  2528. var pa = 0;
  2529. var pe = dst;
  2530. if (self.dst.x == 0) {
  2531. pa = py;
  2532. pe = y;
  2533. self.dst.ay = 1;
  2534. self.dst.py = 0;
  2535. } else if (self.dst.y == 0) {
  2536. pa = px;
  2537. pe = x;
  2538. self.dst.ax = 1;
  2539. self.dst.px = 0;
  2540. }
  2541. var ms = self.getTransitionSpeed(dst);
  2542. if (spd && spd <= 1) ms *= spd;
  2543. if (ms > 0) {
  2544. self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
  2545. } else {
  2546. self.bzscroll = false;
  2547. }
  2548. if (self.timer) return;
  2549. if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
  2550. var sync = 1;
  2551. function scrolling() {
  2552. if (self.cancelAnimationFrame) return true;
  2553. self.scrollrunning = true;
  2554. sync = 1 - sync;
  2555. if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
  2556. var done = 0;
  2557. var sx, sy;
  2558. var sc = sy = self.getScrollTop();
  2559. if (self.dst.ay) {
  2560. sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
  2561. var dr = sc - sy;
  2562. if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
  2563. self.setScrollTop(sc);
  2564. if (sc == self.newscrolly) done = 1;
  2565. } else {
  2566. done = 1;
  2567. }
  2568. var scx = sx = self.getScrollLeft();
  2569. if (self.dst.ax) {
  2570. scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
  2571. var dr = scx - sx;
  2572. if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
  2573. self.setScrollLeft(scx);
  2574. if (scx == self.newscrollx) done += 1;
  2575. } else {
  2576. done += 1;
  2577. }
  2578. if (done == 2) {
  2579. self.timer = 0;
  2580. self.cursorfreezed = false;
  2581. self.bzscroll = false;
  2582. self.scrollrunning = false;
  2583. if (sc < 0) sc = 0;
  2584. else if (sc > self.page.maxh) sc = self.page.maxh;
  2585. if (scx < 0) scx = 0;
  2586. else if (scx > self.page.maxw) scx = self.page.maxw;
  2587. if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
  2588. else {
  2589. if (self.onscrollend) {
  2590. self.triggerScrollEnd();
  2591. }
  2592. }
  2593. } else {
  2594. self.timer = setAnimationFrame(scrolling) || 1;
  2595. }
  2596. };
  2597. self.cancelAnimationFrame = false;
  2598. self.timer = 1;
  2599. if (self.onscrollstart && !self.scrollrunning) {
  2600. var info = {
  2601. "type": "scrollstart",
  2602. "current": {
  2603. "x": px,
  2604. "y": py
  2605. },
  2606. "request": {
  2607. "x": x,
  2608. "y": y
  2609. },
  2610. "end": {
  2611. "x": self.newscrollx,
  2612. "y": self.newscrolly
  2613. },
  2614. "speed": ms
  2615. };
  2616. self.onscrollstart.call(self, info);
  2617. }
  2618. scrolling();
  2619. if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
  2620. self.noticeCursor();
  2621. };
  2622. this.cancelScroll = function() {
  2623. if (self.timer) clearAnimationFrame(self.timer);
  2624. self.timer = 0;
  2625. self.bzscroll = false;
  2626. self.scrollrunning = false;
  2627. return self;
  2628. };
  2629. }
  2630. this.doScrollBy = function(stp, relative) {
  2631. var ny = 0;
  2632. if (relative) {
  2633. ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
  2634. } else {
  2635. var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
  2636. ny = sy - stp;
  2637. }
  2638. if (self.bouncescroll) {
  2639. var haf = Math.round(self.view.h / 2);
  2640. if (ny < -haf) ny = -haf
  2641. else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
  2642. }
  2643. self.cursorfreezed = false;
  2644. var py = self.getScrollTop(true);
  2645. if (ny < 0 && py <= 0) return self.noticeCursor();
  2646. else if (ny > self.page.maxh && py >= self.page.maxh) {
  2647. self.checkContentSize();
  2648. return self.noticeCursor();
  2649. }
  2650. self.doScrollTop(ny);
  2651. };
  2652. this.doScrollLeftBy = function(stp, relative) {
  2653. var nx = 0;
  2654. if (relative) {
  2655. nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
  2656. } else {
  2657. var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
  2658. nx = sx - stp;
  2659. }
  2660. if (self.bouncescroll) {
  2661. var haf = Math.round(self.view.w / 2);
  2662. if (nx < -haf) nx = -haf;
  2663. else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
  2664. }
  2665. self.cursorfreezed = false;
  2666. var px = self.getScrollLeft(true);
  2667. if (nx < 0 && px <= 0) return self.noticeCursor();
  2668. else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
  2669. self.doScrollLeft(nx);
  2670. };
  2671. this.doScrollTo = function(pos, relative) {
  2672. var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
  2673. if (ny < 0) ny = 0;
  2674. else if (ny > self.page.maxh) ny = self.page.maxh;
  2675. self.cursorfreezed = false;
  2676. self.doScrollTop(pos);
  2677. };
  2678. this.checkContentSize = function() {
  2679. var pg = self.getContentSize();
  2680. if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
  2681. };
  2682. self.onscroll = function(e) {
  2683. if (self.rail.drag) return;
  2684. if (!self.cursorfreezed) {
  2685. self.synched('scroll', function() {
  2686. self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
  2687. if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
  2688. self.noticeCursor();
  2689. });
  2690. }
  2691. };
  2692. self.bind(self.docscroll, "scroll", self.onscroll);
  2693. this.doZoomIn = function(e) {
  2694. if (self.zoomactive) return;
  2695. self.zoomactive = true;
  2696. self.zoomrestore = {
  2697. style: {}
  2698. };
  2699. var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
  2700. var win = self.win[0].style;
  2701. for (var a in lst) {
  2702. var pp = lst[a];
  2703. self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
  2704. }
  2705. self.zoomrestore.style.width = self.win.css('width');
  2706. self.zoomrestore.style.height = self.win.css('height');
  2707. self.zoomrestore.padding = {
  2708. w: self.win.outerWidth() - self.win.width(),
  2709. h: self.win.outerHeight() - self.win.height()
  2710. };
  2711. if (cap.isios4) {
  2712. self.zoomrestore.scrollTop = $(window).scrollTop();
  2713. $(window).scrollTop(0);
  2714. }
  2715. self.win.css({
  2716. "position": (cap.isios4) ? "absolute" : "fixed",
  2717. "top": 0,
  2718. "left": 0,
  2719. "z-index": globalmaxzindex + 100,
  2720. "margin": "0px"
  2721. });
  2722. var bkg = self.win.css("backgroundColor");
  2723. if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
  2724. self.rail.css({
  2725. "z-index": globalmaxzindex + 101
  2726. });
  2727. self.zoom.css({
  2728. "z-index": globalmaxzindex + 102
  2729. });
  2730. self.zoom.css('backgroundPosition', '0px -18px');
  2731. self.resizeZoom();
  2732. if (self.onzoomin) self.onzoomin.call(self);
  2733. return self.cancelEvent(e);
  2734. };
  2735. this.doZoomOut = function(e) {
  2736. if (!self.zoomactive) return;
  2737. self.zoomactive = false;
  2738. self.win.css("margin", "");
  2739. self.win.css(self.zoomrestore.style);
  2740. if (cap.isios4) {
  2741. $(window).scrollTop(self.zoomrestore.scrollTop);
  2742. }
  2743. self.rail.css({
  2744. "z-index": self.zindex
  2745. });
  2746. self.zoom.css({
  2747. "z-index": self.zindex
  2748. });
  2749. self.zoomrestore = false;
  2750. self.zoom.css('backgroundPosition', '0px 0px');
  2751. self.onResize();
  2752. if (self.onzoomout) self.onzoomout.call(self);
  2753. return self.cancelEvent(e);
  2754. };
  2755. this.doZoom = function(e) {
  2756. return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
  2757. };
  2758. this.resizeZoom = function() {
  2759. if (!self.zoomactive) return;
  2760. var py = self.getScrollTop(); //preserve scrolling position
  2761. self.win.css({
  2762. width: $(window).width() - self.zoomrestore.padding.w + "px",
  2763. height: $(window).height() - self.zoomrestore.padding.h + "px"
  2764. });
  2765. self.onResize();
  2766. self.setScrollTop(Math.min(self.page.maxh, py));
  2767. };
  2768. this.init();
  2769. $.nicescroll.push(this);
  2770. };
  2771. // Inspired by the work of Kin Blas
  2772. // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
  2773. var ScrollMomentumClass2D = function(nc) {
  2774. var self = this;
  2775. this.nc = nc;
  2776. this.lastx = 0;
  2777. this.lasty = 0;
  2778. this.speedx = 0;
  2779. this.speedy = 0;
  2780. this.lasttime = 0;
  2781. this.steptime = 0;
  2782. this.snapx = false;
  2783. this.snapy = false;
  2784. this.demulx = 0;
  2785. this.demuly = 0;
  2786. this.lastscrollx = -1;
  2787. this.lastscrolly = -1;
  2788. this.chkx = 0;
  2789. this.chky = 0;
  2790. this.timer = 0;
  2791. this.time = function() {
  2792. return +new Date(); //beautifull hack
  2793. };
  2794. this.reset = function(px, py) {
  2795. self.stop();
  2796. var now = self.time();
  2797. self.steptime = 0;
  2798. self.lasttime = now;
  2799. self.speedx = 0;
  2800. self.speedy = 0;
  2801. self.lastx = px;
  2802. self.lasty = py;
  2803. self.lastscrollx = -1;
  2804. self.lastscrolly = -1;
  2805. };
  2806. this.update = function(px, py) {
  2807. var now = self.time();
  2808. self.steptime = now - self.lasttime;
  2809. self.lasttime = now;
  2810. var dy = py - self.lasty;
  2811. var dx = px - self.lastx;
  2812. var sy = self.nc.getScrollTop();
  2813. var sx = self.nc.getScrollLeft();
  2814. var newy = sy + dy;
  2815. var newx = sx + dx;
  2816. self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
  2817. self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
  2818. self.speedx = dx;
  2819. self.speedy = dy;
  2820. self.lastx = px;
  2821. self.lasty = py;
  2822. };
  2823. this.stop = function() {
  2824. self.nc.unsynched("domomentum2d");
  2825. if (self.timer) clearTimeout(self.timer);
  2826. self.timer = 0;
  2827. self.lastscrollx = -1;
  2828. self.lastscrolly = -1;
  2829. };
  2830. this.doSnapy = function(nx, ny) {
  2831. var snap = false;
  2832. if (ny < 0) {
  2833. ny = 0;
  2834. snap = true;
  2835. } else if (ny > self.nc.page.maxh) {
  2836. ny = self.nc.page.maxh;
  2837. snap = true;
  2838. }
  2839. if (nx < 0) {
  2840. nx = 0;
  2841. snap = true;
  2842. } else if (nx > self.nc.page.maxw) {
  2843. nx = self.nc.page.maxw;
  2844. snap = true;
  2845. }
  2846. (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
  2847. };
  2848. this.doMomentum = function(gp) {
  2849. var t = self.time();
  2850. var l = (gp) ? t + gp : self.lasttime;
  2851. var sl = self.nc.getScrollLeft();
  2852. var st = self.nc.getScrollTop();
  2853. var pageh = self.nc.page.maxh;
  2854. var pagew = self.nc.page.maxw;
  2855. self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
  2856. self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
  2857. var chk = l && (t - l) <= 60;
  2858. if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
  2859. var sy = (self.speedy && chk) ? self.speedy : false;
  2860. var sx = (self.speedx && chk) ? self.speedx : false;
  2861. if (sy || sx) {
  2862. var tm = Math.max(16, self.steptime); //timeout granularity
  2863. if (tm > 50) { // do smooth
  2864. var xm = tm / 50;
  2865. self.speedx *= xm;
  2866. self.speedy *= xm;
  2867. tm = 50;
  2868. }
  2869. self.demulxy = 0;
  2870. self.lastscrollx = self.nc.getScrollLeft();
  2871. self.chkx = self.lastscrollx;
  2872. self.lastscrolly = self.nc.getScrollTop();
  2873. self.chky = self.lastscrolly;
  2874. var nx = self.lastscrollx;
  2875. var ny = self.lastscrolly;
  2876. var onscroll = function() {
  2877. var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
  2878. if (self.speedx) {
  2879. nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
  2880. self.lastscrollx = nx;
  2881. if ((nx < 0) || (nx > pagew)) df = 0.10;
  2882. }
  2883. if (self.speedy) {
  2884. ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
  2885. self.lastscrolly = ny;
  2886. if ((ny < 0) || (ny > pageh)) df = 0.10;
  2887. }
  2888. self.demulxy = Math.min(1, self.demulxy + df);
  2889. self.nc.synched("domomentum2d", function() {
  2890. if (self.speedx) {
  2891. var scx = self.nc.getScrollLeft();
  2892. if (scx != self.chkx) self.stop();
  2893. self.chkx = nx;
  2894. self.nc.setScrollLeft(nx);
  2895. }
  2896. if (self.speedy) {
  2897. var scy = self.nc.getScrollTop();
  2898. if (scy != self.chky) self.stop();
  2899. self.chky = ny;
  2900. self.nc.setScrollTop(ny);
  2901. }
  2902. if (!self.timer) {
  2903. self.nc.hideCursor();
  2904. self.doSnapy(nx, ny);
  2905. }
  2906. });
  2907. if (self.demulxy < 1) {
  2908. self.timer = setTimeout(onscroll, tm);
  2909. } else {
  2910. self.stop();
  2911. self.nc.hideCursor();
  2912. self.doSnapy(nx, ny);
  2913. }
  2914. };
  2915. onscroll();
  2916. } else {
  2917. self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
  2918. }
  2919. }
  2920. };
  2921. // override jQuery scrollTop
  2922. var _scrollTop = jQuery.fn.scrollTop; // preserve original function
  2923. jQuery.cssHooks["pageYOffset"] = {
  2924. get: function(elem, computed, extra) {
  2925. var nice = $.data(elem, '__nicescroll') || false;
  2926. return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
  2927. },
  2928. set: function(elem, value) {
  2929. var nice = $.data(elem, '__nicescroll') || false;
  2930. (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
  2931. return this;
  2932. }
  2933. };
  2934. /*
  2935. $.fx.step["scrollTop"] = function(fx){
  2936. $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
  2937. };
  2938. */
  2939. jQuery.fn.scrollTop = function(value) {
  2940. if (typeof value == "undefined") {
  2941. var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
  2942. return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
  2943. } else {
  2944. return this.each(function() {
  2945. var nice = $.data(this, '__nicescroll') || false;
  2946. (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
  2947. });
  2948. }
  2949. };
  2950. // override jQuery scrollLeft
  2951. var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
  2952. $.cssHooks.pageXOffset = {
  2953. get: function(elem, computed, extra) {
  2954. var nice = $.data(elem, '__nicescroll') || false;
  2955. return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
  2956. },
  2957. set: function(elem, value) {
  2958. var nice = $.data(elem, '__nicescroll') || false;
  2959. (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
  2960. return this;
  2961. }
  2962. };
  2963. /*
  2964. $.fx.step["scrollLeft"] = function(fx){
  2965. $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
  2966. };
  2967. */
  2968. jQuery.fn.scrollLeft = function(value) {
  2969. if (typeof value == "undefined") {
  2970. var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
  2971. return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
  2972. } else {
  2973. return this.each(function() {
  2974. var nice = $.data(this, '__nicescroll') || false;
  2975. (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
  2976. });
  2977. }
  2978. };
  2979. var NiceScrollArray = function(doms) {
  2980. var self = this;
  2981. this.length = 0;
  2982. this.name = "nicescrollarray";
  2983. this.each = function(fn) {
  2984. for (var a = 0, i = 0; a < self.length; a++) fn.call(self[a], i++);
  2985. return self;
  2986. };
  2987. this.push = function(nice) {
  2988. self[self.length] = nice;
  2989. self.length++;
  2990. };
  2991. this.eq = function(idx) {
  2992. return self[idx];
  2993. };
  2994. if (doms) {
  2995. for (var a = 0; a < doms.length; a++) {
  2996. var nice = $.data(doms[a], '__nicescroll') || false;
  2997. if (nice) {
  2998. this[this.length] = nice;
  2999. this.length++;
  3000. }
  3001. };
  3002. }
  3003. return this;
  3004. };
  3005. function mplex(el, lst, fn) {
  3006. for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
  3007. };
  3008. mplex(
  3009. NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
  3010. function(e, n) {
  3011. e[n] = function() {
  3012. var args = arguments;
  3013. return this.each(function() {
  3014. this[n].apply(this, args);
  3015. });
  3016. };
  3017. }
  3018. );
  3019. jQuery.fn.getNiceScroll = function(index) {
  3020. if (typeof index == "undefined") {
  3021. return new NiceScrollArray(this);
  3022. } else {
  3023. var nice = this[index] && $.data(this[index], '__nicescroll') || false;
  3024. return nice;
  3025. }
  3026. };
  3027. jQuery.extend(jQuery.expr[':'], {
  3028. nicescroll: function(a) {
  3029. return ($.data(a, '__nicescroll')) ? true : false;
  3030. }
  3031. });
  3032. $.fn.niceScroll = function(wrapper, opt) {
  3033. if (typeof opt == "undefined") {
  3034. if ((typeof wrapper == "object") && !("jquery" in wrapper)) {
  3035. opt = wrapper;
  3036. wrapper = false;
  3037. }
  3038. }
  3039. opt = $.extend({},opt); // cloning
  3040. var ret = new NiceScrollArray();
  3041. if (typeof opt == "undefined") opt = {};
  3042. if (wrapper || false) {
  3043. opt.doc = $(wrapper);
  3044. opt.win = $(this);
  3045. }
  3046. var docundef = !("doc" in opt);
  3047. if (!docundef && !("win" in opt)) opt.win = $(this);
  3048. this.each(function() {
  3049. var nice = $(this).data('__nicescroll') || false;
  3050. if (!nice) {
  3051. opt.doc = (docundef) ? $(this) : opt.doc;
  3052. nice = new NiceScrollClass(opt, $(this));
  3053. $(this).data('__nicescroll', nice);
  3054. }
  3055. ret.push(nice);
  3056. });
  3057. return (ret.length == 1) ? ret[0] : ret;
  3058. };
  3059. window.NiceScroll = {
  3060. getjQuery: function() {
  3061. return jQuery
  3062. }
  3063. };
  3064. if (!$.nicescroll) {
  3065. $.nicescroll = new NiceScrollArray();
  3066. $.nicescroll.options = _globaloptions;
  3067. }
  3068. }));